phenacyl chloride

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 296402074

| Name =

| ImageFile = Chloroacetophenone.svg

| ImageSize = 180px

| ImageClass = skin-invert

| ImageName = Skeletal formula

| ImageFile1 = Phenacyl-chloride-3D-balls.png

| ImageClass1 = bg-transparent

| ImageSize1 = 180px

| ImageName1 = Ball-and-stick model

| PIN = 2-Chloro-1-phenylethan-1-one

| OtherNames = 2-Chloro-1-phenylethanone
α-Chloroacetophenone
2-Chloroacetophenone
Chloromethyl phenyl ketone
Phenyl chloromethyl ketone
CN
Weeping gasVerma, K.S. [https://www.cengage.co.in/category/test-prep/jee-advanced/chemistry/course/physical-chemistry-for-joint-entrance-examination-jee-advanced-part-1-6h Cengage Physical Chemistry Part 1] {{Webarchive|url=https://web.archive.org/web/20210506233242/https://www.cengage.co.in/category/test-prep/jee-advanced/chemistry/course/physical-chemistry-for-joint-entrance-examination-jee-advanced-part-1-6h |date=2021-05-06 }}, Illustration 5.65
Mace

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 6285

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 532-27-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 88B5039IQG

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 105712

| PubChem = 10757

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 10303

| InChI = InChI=1S/C8H7ClO/c9-6-8(10)7-4-2-1-3-5-7/h1-5H,6H2

| SMILES = c1ccc(cc1)C(=O)CCl

}}

|Section2={{Chembox Properties

| C = 8 |H = 7 | O = 1 | Cl = 1

| Density = 1.324 g/cm3

| MeltingPtC = 54 to 56

| BoilingPtC = 244.5

| Solubility = insoluble

| Appearance = white to gray crystalline solid

| Odor = pungent and irritating

| VaporPressure = 0.005 mmHg (20 °C)

}}

|Section7={{Chembox Hazards

| MainHazards = Combustible

| GHSPictograms = {{GHS05}}{{GHS06}}{{GHS08}}

| GHSSignalWord = danger

| HPhrases = {{HPhrases|H300|H311+H331|H315|H318|H334|H335}}

| PPhrases = {{PPhrases|P280|P301+P310+P330|P302+P352+P312|P304+P340+P311|P305+P351+P338+P310}}

| GHS_ref = GHS: [https://gestis.dguv.de/data?name=037810 GESTIS 037810]

| FlashPtC = 88

| AutoignitionPtC =

| NFPA-H = 3

| NFPA-F = 1

| NFPA-R = 0

| NFPA-S =

| ExternalSDS =

| PEL = TWA 0.3 mg/m3 (0.05 ppm){{PGCH|0119}}

| REL = TWA 0.3 mg/m3 (0.05 ppm)

| IDLH = 15 mg/m3

| LCLo = 417 mg/m3 (rat, 15 min)
600 mg/m3 (mouse, 15 min)
465 mg/m3 (rabbit, 20 min)
490 mg/m3 (guinea pig, 30 min)
159 mg/m3 (human, 20 min)
850 mg/m3 (human, 10 min){{IDLH|532274|alpha-Chloroacetophenone}}

}}

}}

Phenacyl chloride, also commonly known as chloroacetophenone, is a substituted acetophenone. It is a useful building block in organic chemistry. Apart from that, it has been historically used as a riot control agent, where it is designated CN.{{Cite journal | last1 = Treudler | first1 = R. | last2 = Tebbe | first2 = B. | last3 = Blume-Peytavi | first3 = U. | last4 = Krasagakis | first4 = K. | last5 = Orfanos | first5 = C. E. | title = Occupational contact dermatitis due to 2-chloracetophenone tear gas | doi = 10.1046/j.1365-2133.1999.02724.x | journal = British Journal of Dermatology | volume = 140 | issue = 3 | pages = 531–534 | year = 1999 | pmid = 10233281| s2cid = 45123933 }} It should not be confused with cyanide, another agent used in chemical warfare, which has the chemical structure CN. Chloroacetophenone is thermally stable, and is the only tear agent that is distillable at ambient conditions.

Preparation

Chloroacetophenone was first synthetized by Carl Graebe in 1871 by passing chlorine into boiling acetophenone.{{Cite journal |last=Graebe |first=C. |date=1871 |title=Ueber eine neue Klasse von Alkoholen |url=https://books.google.com/books?id=lJVTAAAAcAAJ&pg=PA34 |journal=Berichte der deutschen chemischen Gesellschaft |language=en |volume=4 |issue=1 |pages=34–35 |doi=10.1002/cber.18710040116 |issn=0365-9496}}

Phenacyl chloride is readily available and was first prepared by chlorination of acetophenone vapour.{{cite journal |doi=10.1039/CA8783400392 |doi-access=free |title=Ketones of the aromatic group|journal=Journal of the Chemical Society, Abstracts |year=1878 |volume=34 |page=419 }} It may also be synthesized by the Friedel-Crafts acylation of benzene using chloroacetyl chloride, with an aluminium chloride catalyst:{{OrgSynth | title = ω-Chloroisonitrosoacetophenone | author = Levin, N. | author2 = Hartung, W. H. | collvol = 3 | collvolpages = 191 | year = 1955 | prep = cv3p0191}}

:File:Preparation of phenacyl chloride.png

Riot control agent

It was investigated, but not used, during the First and Second World Wars (it was used as a "green agent" by the former Japanese military during the Sino-Japanese War).

Because of CN's significantly greater toxicity,{{Cite journal | last1 = Ballantyne | first1 = B. | last2 = Swanston | first2 = D. W. | doi = 10.1007/BF01891962 | title = The comparative acute mammalian toxicity of 1-chloroacetophenone (CN) and 2-chlorobenzylidene malononitrile (CS) | journal = Archives of Toxicology | volume = 40 | issue = 2 | pages = 75–95 | year = 1978 | pmid = 350195| bibcode = 1978ArTox..40...75B | s2cid = 35150415 }} CN has largely been supplanted for military use by CS gas. Even though CN is still supplied to paramilitary and police forces in a small pressurized aerosol known as “Mace” or tear gas, CN's use is falling because pepper spray both works and disperses more quickly than CN and is less toxic than CN.

The term "Mace" came into being because it was the brand-name invented by one of the first American manufacturers of CN aerosol sprays. Subsequently, in the United States, Mace became synonymous with tear-gas sprays in the same way that Kleenex has become strongly associated with facial tissues (a phenomenon known as a genericized trademark).

Like CS gas, this compound irritates the mucous membranes (oral, nasal, conjunctival and tracheobronchial). Sometimes it can give rise to more generalized reactions such as syncope, temporary loss of balance and orientation. More rarely, cutaneous irritating outbreaks have been observed and allergic contact permanent dermatitis.

At high concentrations, CN may cause corneal epithelial damage and chemosis. It has also accounted for at least five deaths, which have resulted from pulmonary injury and/or asphyxia.{{ cite journal | last = Blain | first = P. G. | title = Tear Gases and Irritant Incapacitants: 1-Chloroacetophenone, 2-Chlorobenzylidene Malononitrile and Dibenz[b,f]-1,4-Oxazepine | journal = Toxicological Reviews | volume = 22 | issue = 2 | pages = 103–110 | year = 2003 | pmid = 15071820 | doi=10.2165/00139709-200322020-00005| s2cid = 21164652 }}

TRPA1 (Transient Receptor Potential-Ankyrin 1) ion channel expressed on nociceptors (especially trigeminal) has been implicated as the site of action for CN, in vivo and in vitro. doi=10.1096/fj.08-117812doi=10.1016/j.taap.2008.04.005

References

{{Reflist}}