phenoxathiin

{{Chembox

| ImageFile = Phenoxathiin.svg

| ImageSize = 200px

| ImageAlt =

| PIN = Phenoxathiine

| OtherNames = 1,4-Dibenzothioxine

| Section1 = {{Chembox Identifiers

| CASNo = 262-20-4

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = BJC51V8XW8

| PubChem = 9217

| ChemSpiderID = 8862

| SMILES = c1ccc2c(c1)Oc3ccccc3S2

| StdInChI=1S/C12H8OS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8H

| StdInChIKey = GJSGGHOYGKMUPT-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=12|H=8|O=1|S=1

| Appearance =

| Density =

| MeltingPtC = 52-56

| MeltingPt_ref = {{cite web | url = http://www.sigmaaldrich.com/catalog/product/aldrich/218820?lang=en | title = Phenoxathiin | publisher = Sigma-Aldrich}}

| BoilingPtC = 150-152

| BoilingPt_notes = (at 5 mmHg)

| BoilingPt_ref =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Phenoxathiin (dibenzooxathiane) C₁₂H₈OS is a heterocyclic compound of molecular weight 200.25632 g/mol with the CAS Registry Number 262-20-4.The Chemistry of Phenoxathiin and its Derivatives. Clara L. Deasy Chem. Rev., 1943, 32 (2), pp 173–194 DOI: 10.1021/cr60102a001 Publication Date: April 1943

Diphenyl ether is a starting material in the production of phenoxathiin via the Ferrario reaction.{{OrgSynth

| author = Suter, C. M.

| author2 = Maxwell, C. E.

| title = Phenoxthin

| journal = Organic Syntheses

| collvol = 2

| issue =

| collvolpages = 485

| year = 1943

| prep = cv2p0485}} Phenoxathiin is used in polyamide and polyimide production.{{cite journal

|author1=Mitsuru Ueoda |author2=Tatsuo Aizawa |author3=Yoshio Imai | title = Preparation and properties of polyamides and polyimides containing phenoxathiin units

| journal = Journal of Polymer Science: Polymer Chemistry Edition

| volume = 15

| issue = 11

| pages = 2739–2747

| year = 1977

| publisher =

| location =

| doi =10.1002/pol.1977.170151119 }}