phenylethylpyrrolidine

{{Chembox

| ImageFile = Phenylethylpyrrolidine.svg

| ImageSize = 200px

| PIN = 1-(2-Phenylethyl)pyrrolidine

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 6273-83-2

| PubChem = 411735

| ChemSpiderID = 364511

| SMILES = c1c(cccc1)CCN2CCCC2

| InChI = InChI=1S/C12H17N/c1-2-6-12(7-3-1)8-11-13-9-4-5-10-13/h1-3,6-7H,4-5,8-11H2

}}

|Section2={{Chembox Properties

| C = 12 | H = 17 | N = 1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

1-(2-Phenylethyl)pyrrolidine (PEP) is a chemical compound. It is an analogue of 2-phenylethylamine where the amine has been replaced by a pyrrolidine ring. The β-keto derivative is phenacylpyrrolidine and the α-methyl and β-keto (i.e., cathinone) derivative is α-pyrrolidinopropiophenone (α-PPP).

PEP is the base chemical structure for a series of stimulant drugs, including:

{{div col|colwidth=10em}}

{{div col end}}

All of these compounds differ from PEP in that the alpha carbon is extended and a ketone is attached to the beta carbon (with the exception of prolintane), among other modifications.

See also

References

{{Reflist}}

{{Stimulants}}

{{Phenethylamines}}

{{Chemical classes of psychoactive drugs}}

Category:1-Pyrrolidinyl compounds

Category:Pyrrolidinophenones

Category:Stimulants

{{organic-compound-stub}}