phenylethylpyrrolidine
{{Chembox
| ImageFile = Phenylethylpyrrolidine.svg
| ImageSize = 200px
| PIN = 1-(2-Phenylethyl)pyrrolidine
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 6273-83-2
| PubChem = 411735
| ChemSpiderID = 364511
| SMILES = c1c(cccc1)CCN2CCCC2
| InChI = InChI=1S/C12H17N/c1-2-6-12(7-3-1)8-11-13-9-4-5-10-13/h1-3,6-7H,4-5,8-11H2
}}
|Section2={{Chembox Properties
| C = 12 | H = 17 | N = 1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
1-(2-Phenylethyl)pyrrolidine (PEP) is a chemical compound. It is an analogue of 2-phenylethylamine where the amine has been replaced by a pyrrolidine ring. The β-keto derivative is phenacylpyrrolidine and the α-methyl and β-keto (i.e., cathinone) derivative is α-pyrrolidinopropiophenone (α-PPP).
PEP is the base chemical structure for a series of stimulant drugs, including:
{{div col|colwidth=10em}}
{{div col end}}
All of these compounds differ from PEP in that the alpha carbon is extended and a ketone is attached to the beta carbon (with the exception of prolintane), among other modifications.
See also
References
{{Reflist}}
{{Stimulants}}
{{Phenethylamines}}
{{Chemical classes of psychoactive drugs}}
Category:1-Pyrrolidinyl compounds
{{organic-compound-stub}}