phosphomevalonic acid

{{chembox

| Verifiedfields = changed

| verifiedrevid = 265840841

| ImageFile=Phosphomevalonic acid.svg

| ImageSize=

| IUPACName=3-hydroxy-3-methyl- 5-phosphonooxy-pentanoic acid

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=1189-94-2

| PubChem=476

| SMILES=CC(CCOP(=O)(O)O)(CC(=O)O)O

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 463

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C6H13O7P/c1-6(9,4-5(7)8)2-3-13-14(10,11)12/h9H,2-4H2,1H3,(H,7,8)(H2,10,11,12)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = OKZYCXHTTZZYSK-UHFFFAOYSA-N

| MeSHName=Phosphomevalonic+acid

}}

|Section2={{Chembox Properties

| Formula=C₆H₁₃O₇P

| MolarMass=228.137 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Phosphomevalonic acid is an intermediate in the Mevalonate pathway.{{Cite journal |last=Miziorko |first=Henry M. |title=Enzymes of the mevalonate pathway of isoprenoid biosynthesis |date=2011-01-15 |journal=Archives of Biochemistry and Biophysics |volume=505 |issue=2 |pages=131–143 |doi=10.1016/j.abb.2010.09.028 |issn=0003-9861 |pmc=3026612 |pmid=20932952}}

Image:Mevalonate pathway.png. (Phosphomevalonic acid labeled as "mevalonate-5-phosphate" ]]