pibrentasvir
{{Short description|NS5A inhibitor antiviral agent}}
{{Infobox drug
| drug_name =
| IUPAC_name = Methyl {(2S,3R)-1-[(2S)-2-{5-[(2R,5R)-1-{3,5-difluoro-4-[4-(4-fluorophenyl)-1-piperidinyl]phenyl}-5-(6-fluoro-2-{(2S)-1-[N-(methoxycarbonyl)-O-methyl-L-threonyl]-2-pyrrolidinyl}-1H-benzimidazol-5-yl)-2-pyrrolidinyl]-6-fluoro-1H-benzimidazol-2-yl}-1-pyrrolidinyl]-3-methoxy-1-oxo-2-butanyl}carbamate
| image = Pibrentasvir.svg
| image_class = skin-invert-image
| alt =
| caption =
| pronounce =
| tradename = Mavyret, Maviret (combination with glecaprevir)
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_US =
| pregnancy_category=
| routes_of_administration =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_DE =
| legal_NZ =
| legal_UK =
| legal_US =
| legal_UN =
| legal_status =
| bioavailability =
| protein_bound = >99.9%
| metabolism =
| metabolites =
| onset =
| elimination_half-life = 13 hours
| duration_of_action =
| excretion = 96.6% in faeces
| CAS_number = 1353900-92-1
| class =
| ATCvet =
| ATC_prefix =
| ATC_suffix =
| PubChem = 58031952
| ChemSpiderID = 35013016
| DrugBank = DB13878
| UNII = 2WU922TK3L
| KEGG = D10816
| synonyms = ABT-530
| C=57|H=65|F=5|N=10|O=8
| smiles = C[C@H]([C@@H](C(=O)N1CCC[C@H]1c2[nH]c3cc(c(cc3n2)[C@H]4CC[C@@H](N4c5cc(c(c(c5)F)N6CCC(CC6)c7ccc(cc7)F)F)c8cc9c(cc8F)[nH]c(n9)[C@@H]1CCCN1C(=O)[C@H]([C@@H](C)OC)NC(=O)OC)F)NC(=O)OC)OC
| StdInChI=1S/C57H65F5N10O8/c1-29(77-3)49(67-56(75)79-5)54(73)70-19-7-9-47(70)52-63-41-25-35(37(59)27-43(41)65-52)45-15-16-46(72(45)34-23-39(61)51(40(62)24-34)69-21-17-32(18-22-69)31-11-13-33(58)14-12-31)36-26-42-44(28-38(36)60)66-53(64-42)48-10-8-20-71(48)55(74)50(30(2)78-4)68-57(76)80-6/h11-14,23-30,32,45-50H,7-10,15-22H2,1-6H3,(H,63,65)(H,64,66)(H,67,75)(H,68,76)/t29-,30-,45-,46-,47+,48+,49+,50+/m1/s1
| StdInChIKey=VJYSBPDEJWLKKJ-NLIMODCCSA-N
}}
Pibrentasvir is an NS5A inhibitor antiviral agent.{{cite journal | vauthors = Ng TI, Krishnan P, Pilot-Matias T, Kati W, Schnell G, Beyer J, Reisch T, Lu L, Dekhtyar T, Irvin M, Tripathi R, Maring C, Randolph JT, Wagner R, Collins C | display-authors = 6 | title = In Vitro Antiviral Activity and Resistance Profile of the Next-Generation Hepatitis C Virus NS5A Inhibitor Pibrentasvir | journal = Antimicrobial Agents and Chemotherapy | volume = 61 | issue = 5 | pages = e02558–16 | date = May 2017 | pmid = 28193664 | pmc = 5404558 | doi = 10.1128/AAC.02558-16 }} In the United States and Europe, it is approved for use with glecaprevir as the combination drug glecaprevir/pibrentasvir (trade name Mavyret in the US and Maviret in the EU) for the treatment of hepatitis C.{{Cite news | title = FDA OKs new drug to treat all forms of hepatitis C | vauthors = Johnson LA | date = August 3, 2017 | url = http://www.foxbusiness.com/markets/2017/08/03/fda-oks-new-drug-to-treat-all-forms-hepatitis-c.html | publisher = Fox Business }}{{cite web |url=http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Summary_for_the_public/human/004430/WC500233680.pdf |title=Maviret: EPAR – Summary for the public |publisher=European Medicines Agency |date=2017-08-17 |access-date=2017-10-19 |archive-date=2017-10-19 |archive-url=https://web.archive.org/web/20171019163924/http://www.ema.europa.eu/docs/en_GB/document_library/EPAR_-_Summary_for_the_public/human/004430/WC500233680.pdf |url-status=dead }} It is sold by Abbvie.{{cn|date=January 2023}}