pindobind

{{Chembox

| ImageFile = Pindobind.svg

| ImageSize = 200px

| IUPACName = 2-Bromo-N-[4-(2-{[2-hydroxy-3-(1H-indol-4-yloxy)propyl]amino}-2-propanyl)-1-methylcyclohexyl]acetamide

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 106469-52-7

| CASNo_Ref = {{cascite|correct|}}

| PubChem = 4827

| ChemSpiderID = 4661

| SMILES = BrCC(=O)NC1(C)CCC(CC1)C(NCC(O)COc2cccc3c2cc[nH]3)(C)C

| InChI = 1/C23H34BrN3O3/c1-22(2,16-7-10-23(3,11-8-16)27-21(29)13-24)26-14-17(28)15-30-20-6-4-5-19-18(20)9-12-25-19/h4-6,9,12,16-17,25-26,28H,7-8,10-11,13-15H2,1-3H3,(H,27,29)

| InChIKey = XSAGAZCYTLNCEN-UHFFFAOYAL

| StdInChI = 1S/C23H34BrN3O3/c1-22(2,16-7-10-23(3,11-8-16)27-21(29)13-24)26-14-17(28)15-30-20-6-4-5-19-18(20)9-12-25-19/h4-6,9,12,16-17,25-26,28H,7-8,10-11,13-15H2,1-3H3,(H,27,29)

| StdInChIKey = XSAGAZCYTLNCEN-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=23 | H=34 | Br=1 | N=3 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Pindobind is a compound developed by researchers associated with Stanford University,{{Citation|last=Peroutka|first=Stephen J.|title=Method for relieving anxiety using 5-hydroxytryptamine-1a-receptor-binding compounds|date=Jul 20, 1993|url=https://patents.google.com/patent/US5229412|last2=Pitha|first2=Josef|access-date=2016-06-04}} identified as a central nervous system depressant,{{cite journal | pmid = 8255924 | year = 1993 | last1 = Bell | first1 = R | last2 = Hobson | first2 = H | title = Effects of pindobind 5-hydroxytryptamine1A (5-HT1A), a novel and potent 5-HT1A antagonist, on social and agonistic behaviour in male albino mice | volume = 46 | issue = 1 | pages = 67–72 | journal = Pharmacology Biochemistry and Behavior | doi=10.1016/0091-3057(93)90318-N}} which generated a response in animals reducing offensive actions such as chasing, while also notably reducing tendencies of the test animal to evade when stimulated to do so. It acts as an irreversible beta blocker and irreversible 5-HT_1A receptor antagonist.