pindone

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464206843

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageFile=Pindone Structural Formula V.1.svg

| PIN= 2-(2,2-Dimethylpropanoyl)-1H-indene-1,3(2H)-dione

| OtherNames=2-Pivaloyl-1,3-indandione

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6476

| InChI = 1/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3

| InChIKey = RZKYEQDPDZUERB-UHFFFAOYAX

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RZKYEQDPDZUERB-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=83-26-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2KFI1XBH7G

| PubChem=6732

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C19141

| SMILES = O=C2c1ccccc1C(=O)C2C(=O)C(C)(C)C

}}

|Section2={{Chembox Properties

| Formula=C₁₄H₁₄O₃

| MolarMass=230.26 g/mol

| Appearance=Bright-yellow powder

| Odor = almost none

| Density=1.06 g/mL

| MeltingPtC=110

| BoilingPtC=

| Solubility= 0.002% (25°C)

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

| PEL = TWA 0.1 mg/m³{{PGCH|0516}}

| IDLH = 100 mg/m³

| REL = TWA 0.1 mg/m³

| LD50 = 280 mg/kg (rat, oral)
75 mg/kg (dog, oral)
150 mg/kg (rabbit, oral){{IDLH|83261|Pindone}}

}}

}}

Pindone is an anticoagulant drug{{cite journal |vauthors=Robinson MH, Twigg LE, Wheeler SH, Martin GR |title=Effect of the anticoagulant, pindone, on the breeding performance and survival of merino sheep, Ovis aries |journal=Comp. Biochem. Physiol. B |volume=140 |issue=3 |pages=465–73 |date=March 2005 |pmid=15694595 |doi=10.1016/j.cbpc.2004.11.011 }} for agricultural use. It is commonly used as a rodenticide in the management of rat and rabbit populations.

It is pharmacologically analogous to warfarin and inhibits the synthesis of Vitamin K-dependent clotting factors.