pinotin A

{{chembox

| Watchedfields = changed

| verifiedrevid = 448394816

| Name = Pinotin A

| ImageFile = Pinotin A.svg

| ImageSize = 200px

| ImageName = Chemical structure of pinotin A

| ImageAlt = Chemical structure of pinotin A

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 663910-41-6

| CASNo_Ref = {{Cascite|changed|CAS}}

| PubChem = 21674154

| ChemSpiderID = 10286568

| SMILES = COc1cc(cc(c1O)OC)c2c(c3c4c([o+]2)cc(cc4OC(=C3)c5ccc(c(c5)O)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O

| StdInChI = 1S/C31H28O14/c1-40-21-6-13(7-22(41-2)25(21)36)29-30(45-31-28(39)27(38)26(37)23(11-32)44-31)15-10-18(12-3-4-16(34)17(35)5-12)42-19-8-14(33)9-20(43-29)24(15)19/h3-10,23,26-28,31-32,37-39H,11H2,1-2H3,(H3-,33,34,35,36)/p+1/t23-,26-,27+,28-,31+/m1/s1

| StdInChIKey = RFTHDRVOYDHSOC-BGXVWEPQSA-O

| MeSHName =

}}

|Section2={{Chembox Properties

| Formula = C31H29O14+

| MolarMass = 625.55 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| GHS_ref =

}}

}}

Pinotin A is a pinotin, a type of pyranoanthocyanins and a class of phenolic compounds found in red wine.Investigations on Anthocyanins in Wines from Vitis vinifera cv. Pinotage: Factors Influencing the Formation of Pinotin A and Its Correlation with Wine Age. Schwarz Michael, Hofmann Glenn and Winterhalter Peter, J. Agric. Food Chem., 2004, 52 (3): 498–504. {{doi|10.1021/jf035034f}}Variation of pyranoanthocyanins in red wines of different varieties and vintages and the impact of pinotin A addition on their color parameters. Michael Rentzsch, Fabian Weber, Dominik Durner, Ulrich Fischer and Peter Winterhalter, European Food Research and Technology, Volume 229, Number 4, pp. 689-696, {{doi|10.1007/s00217-009-1102-4}}

See also

References

{{reflist}}