piperidolate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 408699870

| IUPAC_name = 1-Ethylpiperidin-3-yl diphenylacetate

| image = Piperidolate.png

| tradename = Dactil

| Drugs.com = {{drugs.com|international|piperidolate}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 82-98-4

| ATC_prefix = A03

| ATC_suffix = AA30

| PubChem = 4839

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB13351

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RJO31255V9

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08382

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1474977

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4673

| C=21 | H=25 | N=1 | O=2

| smiles = CCN1CCCC(C1)OC(=O)C(C2=CC=CC=C2)C3=CC=CC=C3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C21H25NO2/c1-2-22-15-9-14-19(16-22)24-21(23)20(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,19-20H,2,9,14-16H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = KTHVBAZBLKXIHZ-UHFFFAOYSA-N

}}

Piperidolate is a pharmaceutical drug used to treat the symptoms of gastrointestinal disorders including gastric and duodenal ulcers, gastritis, enteritis, gallstones, cholecystitis, and biliary dyskinesia.{{cite web | url = https://drugs.ncats.io/drug/RJO31255V9 | title = Piperidolate | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences }} It acts as an antimuscarinic agent.{{cite web | url = https://www.drugs.com/international/piperidolate.html | title = Piperidolate | website = drugs.com }}{{cite book | vauthors = Vardanyan R |title=Piperidine-Based Drug Discovery |date=2017 |publisher=Elsevier Science |isbn=978-0-12-813428-3 |pages=130}} It was first approved in 1954 and is no longer marketed in the United States.