pipramadol

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Pipramadol

| image = Pipramadol v2.svg

| width = 200px

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 55313-67-2

| CAS_supplemental =

| PubChem = 3047849

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 2310156

| UNII = 24HB54N554

| KEGG =

| ChEBI =

| ChEMBL = 146727

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = FQ 27-096

| IUPAC_name = 2-[1-[2-(2-Chlorophenyl)ethyl]-4-hydroxypiperidin-4-yl]-N-cyclohexyl-N-methylpropanamide

| C=23 | H=35 | Cl=1 | N=2 | O=2

| SMILES = CC(C(=O)N(C)C1CCCCC1)C2(CCN(CC2)CCC3=CC=CC=C3Cl)O

| StdInChI = 1S/C23H35ClN2O2/c1-18(22(27)25(2)20-9-4-3-5-10-20)23(28)13-16-26(17-14-23)15-12-19-8-6-7-11-21(19)24/h6-8,11,18,20,28H,3-5,9-10,12-17H2,1-2H3

| StdInChIKey = JRLWHJKUNYBJRC-UHFFFAOYSA-N

}}

Pipramadol is an opioid narcotic with potent analgesic properties.{{cite journal | vauthors = Huegi BS, Ebnöther AM, Rissi E, Gadient F, Hauser D, Roemer D, Hill RC, Buescher HH, Petcher TJ | title = Synthesis and pharmacological studies of 4,4-disubstituted piperidines: a new class of compounds with potent analgesic properties | journal = Journal of Medicinal Chemistry | volume = 26 | issue = 1 | pages = 42–50 | date = January 1983 | pmid = 6600791 | doi = 10.1021/jm00355a010 }}{{cite journal | vauthors = Kurbat NM, Praliev KD, Salita TA, Yu VK, Verina EL |title=Neuropharmacological activity of piperidine derivatives (a review) |journal=Pharmaceutical Chemistry Journal |date=July 1991 |volume=25 |issue=7 |pages=450–462 |doi=10.1007/BF00771998}}

See also

References