pirolate

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = ethyl 7,8-dimethoxy-4-oxo-1,4-dihydropyrimido[4,5-b]quinoline-2-carboxylate

| image = Pirolate.svg

| tradename =

| pregnancy_category =

| legal_status = ?

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 55149-05-8

| ATC_prefix = none

| ATC_suffix =

| PubChem = 5361200

| ChemSpiderID = 4514698

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2LF7L6QD58

| KEGG = D05508

| C=16 | H=15 | N=3 | O=5

| smiles = O=C(OCC)C/1=N/C(=O)c2cc3cc(OC)c(OC)cc3nc2N\1

}}

Pirolate (CP-32,387) is an antihistamine drug with a tricyclic chemical structure which was patented as an "antiallergen".{{cite book | vauthors = Triggle DJ | title = Dictionary of Pharmacological Agents | publisher = Chapman & Hall/CRC | location = Boca Raton | year = 1996 | isbn = 0-412-46630-9 }}{{cite book | vauthors = Temple DL | title = Drugs affecting the respiratory system: based on a symposium sponsored by the Division of Medicinal Chemistry, at the 175th meeting of the American Chemical Society, Anaheim, California, March 13-16, 1978 | publisher = The Society | location = New Hope, Pa | year = 1980 | isbn = 0-8412-0536-1 | url-access = registration | url = https://archive.org/details/drugsaffectingre00temp }} It was never marketed and there are very few references to it in the literature.