polygodial
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 417596292
| ImageFile=Polygodial.svg
| ImageSize=180px
| IUPACName = Drim-7-ene-11,12-dial
| SystematicName = (1R,4aS,8aS)-5,5,8a-Trimethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalene-1,2-dicarbaldehyde
| OtherNames = Poligodial; Tadeodal; Tadeonal
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo=6754-20-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5FAF7T66M7
| PubChem=72503
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 254550
| SMILES=CC1(CCC[C@]2([C@H]1CC=C([C@@H]2C=O)C=O)C)C
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 65414
| InChI = 1/C15H22O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,9-10,12-13H,4,6-8H2,1-3H3/t12-,13-,15+/m0/s1
| InChIKey = AZJUJOFIHHNCSV-KCQAQPDRBV
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H22O2/c1-14(2)7-4-8-15(3)12(10-17)11(9-16)5-6-13(14)15/h5,9-10,12-13H,4,6-8H2,1-3H3/t12-,13-,15+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = AZJUJOFIHHNCSV-KCQAQPDRSA-N
}}
|Section2={{Chembox Properties
| C=15 | H=22 | O=2
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Polygodial is chemical compound found in dorrigo pepper, mountain pepper, horopito, canelo, paracress, water-pepper, and Dendrodoris limbata.Beattie, G.A.C., Spray Oils Beyond 2000, University of Western Queensland, {{ISBN|1-86341-902-0}}{{Cite journal | doi = 10.1055/s-2007-971422 | pmid = 7089094 | title = Antibiotic Substances from New Zealand Plants | journal = Planta Medica | volume = 44 | issue = 3 | pages = 134–138 | year = 1982 | last1 = McCallion | first1 = Rosemary | last2 = Cole | first2 = A. | last3 = Walker | first3 = J. | last4 = Blunt | first4 = J. | last5 = Munro | first5 = M. }}{{Cite journal | doi = 10.1016/j.bse.2006.10.019 | title = Presence of polygodial and drimenol in Drimys populations from Chile | journal = Biochemical Systematics and Ecology | volume = 35 | issue = 7 | pages = 434–438 | year = 2007 | last1 = Muñoz-Concha | first1 = Diego | last2 = Vogel | first2 = Hermine | last3 = Yunes | first3 = Rosendo | last4 = Razmilic | first4 = Iván | last5 = Bresciani | first5 = Louisiane | last6 = Malheiros | first6 = Angela | bibcode = 2007BioSE..35..434M }}
{{cite thesis
|last = Jonassohn
|first = Mikael
|date = 1996
|title = Sesquiterpenoid unsaturated dialdehydes: structural properties that affect reactivity and bioactivity
|type = PhD
|publisher = Lund University
|isbn = 91-628-2215-2
|url=http://www.organic.lu.se/Publications/Ph.%20D.%20theses/Jonassohn.pdf |access-date=2008-01-30 |url-status=dead |archive-url=https://web.archive.org/web/20111003033550/http://www.organic.lu.se/Publications/Ph.%20D.%20theses/Jonassohn.pdf |archive-date=2011-10-03 }}
Chemically it is a drimane-type sesquiterpene dialdehyde of formula C15H22O2.
Polygodial elicits a warm and pungent flavour.
The compound activates the TRPA1 pain receptor in nerve endings in the mouth that mediate the sensation of pungency.{{Cite journal |last=Escalera |first=Jasmine |last2=von Hehn |first2=Christian A. |last3=Bessac |first3=Bret F. |last4=Sivula |first4=Michael |last5=Jordt |first5=Sven-Eric |date=2008-10-29 |title=TRPA1 Mediates the Noxious Effects of Natural Sesquiterpene Deterrents |url=https://linkinghub.elsevier.com/retrieve/pii/S0021925819493253 |journal=Journal of Biological Chemistry |language=en |volume=283 |issue=35 |pages=24136–24144 |doi=10.1074/jbc.M710280200 |pmc=2527119 |pmid=18550530 |doi-access=free}}
The in vitro biological activity of polygodial has been reported in the scientific literature to include antifungal and antimicrobial activities,{{Cite journal | doi = 10.1055/s-2006-960114 | pmid = 1775575 | title = Comparison of the Antimicrobial and Cytotoxic Activities of Twenty Unsaturated Sesquiterpene Dialdehydes from Plants and Mushrooms | journal = Planta Medica | volume = 57 | issue = 4 | pages = 344–346 | year = 1991 | last1 = Anke | first1 = Heidrun | last2 = Sterner | first2 = Olov }}{{Cite journal | doi = 10.1055/s-1999-13981 | pmid = 10232062 | title = In Vitro Antifungal Susceptibilities of Candida albicans and Other Fungal Pathogens to Polygodial, a Sesquiterpene Dialdehyde | journal = Planta Medica | volume = 65 | issue = 3 | pages = 204–208 | year = 1999 | last1 = Lee | first1 = Sang Hwa | last2 = Lee | first2 = Jae Ran | last3 = Lunde | first3 = Christopher S. | last4 = Kubo | first4 = Isao }}{{Cite journal | doi = 10.1021/jf000136g | pmid = 11312903 | title = Antifungal Mechanism of Polygodial | journal = Journal of Agricultural and Food Chemistry | volume = 49 | issue = 3 | pages = 1607–1611 | year = 2001 | last1 = Kubo | first1 = Isao | last2 = Fujita | first2 = Ken'Ichi | last3 = Lee | first3 = Sang Hwa }} antihyperalgesia,{{Cite journal | doi = 10.1016/s0024-3205(98)00285-9 | pmid = 9714424 | title = Anti-hyperalgesic properties of the extract and of the main sesquiterpene polygodial isolated from the barks of Drymis winteri (Winteraceae) | journal = Life Sciences | volume = 63 | issue = 5 | pages = 369–381 | year = 1998 | last1 = Mendes | first1 = Gilboé L. | last2 = Santos | first2 = Adair R.S. | last3 = Campos | first3 = Maria M. | last4 = Tratsk | first4 = Karla S. | last5 = Yunes | first5 = Rosendo A. | last6 = Filho | first6 = Valdir Cechinel | last7 = Calixto | first7 = Joăo B. }} potent attachment-inhibitory activity,{{Cite journal | doi=10.1271/bbb.64.2699 |pmid = 11210140|title = Polygodial, a Potent Attachment-inhibiting Substance for the Blue Mussel,Mytilus edulis galloprovincialisfrom Tasmannia lanceolata|journal = Bioscience, Biotechnology, and Biochemistry|volume = 64|issue = 12|pages = 2699–2701|year = 2000|last1 = Ban|first1 = Takahiro|last2 = Singh|first2 = Inder Pal|last3 = Etoh|first3 = Hideo|doi-access = free}} insect antifeedant activity,{{Cite journal | doi = 10.1021/np50050a002 | pmid = 3655790 | title = Insect Antifeedant Activity and Hot Taste for Humans of Selected Natural and Synthetic 1,4-Dialdehydes | journal = Journal of Natural Products | volume = 50 | issue = 2 | pages = 146–151 | year = 1987 | last1 = Caprioli | first1 = Vincenzo | last2 = Cimino | first2 = Guido | last3 = Colle | first3 = Roberto | last4 = Gavagnin | first4 = Margherita | last5 = Sodano | first5 = Guido | last6 = Spinella | first6 = Aldo }} antinociception,{{cite journal | pmid = 10604944 | year = 2000 | last1 = Mendes | first1 = G. L. | title = Assessment of mechanisms involved in antinociception caused by sesquiterpene polygodial | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 292 | issue = 1 | pages = 164–72 | last2 = Santos | first2 = A. R. | last3 = Malheiros | first3 = A. | last4 = Filho | first4 = V. C. | last5 = Yunes | first5 = R. A. | last6 = Calixto | first6 = J. B. }}{{Cite journal | doi=10.1016/s0031-9422(00)00515-x | pmid=11336250 | title=A sesquiterpene drimane with antinociceptive activity from Drimys winteri bark | journal=Phytochemistry | volume=57 | issue=1 | pages=103–107 | year=2001 | last1=Malheiros | first1=Angela | last2=Filho | first2=Valdir Cechinel | last3=Schmitt | first3=Clarisse B. | last4=Santos | first4=Adair R.S | last5=Scheidt | first5=Cristiano | last6=Calixto | first6=João B. | last7=Monache | first7=Franco Delle | last8=Yunes | first8=Rosendo A. | bibcode=2001PChem..57..103M }} vasorelaxing action in vessels of rabbit and guinea pig,{{Cite journal | doi=10.1016/s0014-2999(99)00719-0 |pmid = 10611463|title = Mechanisms underlying the relaxation caused by the sesquiterpene polygodial in vessels from rabbit and guinea-pig|journal = European Journal of Pharmacology|volume = 386|pages = 47–53|year = 1999|last1 = André|first1 = Eunice|last2 = Malheiros|first2 = Ângela|last3 = Cechinel-Filho|first3 = Valdir|last4 = Yunes|first4 = Rosendo A.|last5 = Calixto|first5 = João B.| issue=1 }} anti-inflammatory and antiallergic activities.{{Cite journal | doi=10.1007/s000110050234 | pmid=9459082 | title=Anti-allergic effects and oedema inhibition caused by the extract of Drymis winteri | journal=Inflammation Research | volume=46 | issue=12 | pages=509–514 | year=1997 | last1=Tratsk | first1=K. S. | last2=Campos | first2=M. M. | last3=Vaz | first3=Z. R. | last4=Filho | first4=V. C. | last5=Schlemper | first5=V. | last6=Yunes | first6=R. A. | last7=Calixto | first7=J. B. | s2cid=206862953 }}{{Cite journal | doi=10.1016/s0024-3205(01)01387-x | pmid=11787941 | title=Additional evidence for the anti-inflammatory and anti-allergic properties of the sesquiterpene polygodial | journal=Life Sciences | volume=70 | issue=2 | pages=159–169 | year=2001 | last1=Da Cunha | first1=Fernanda M. | last2=Fröde | first2=Tânia S. | last3=Mendes | first3=Gilboé L. | last4=Malheiros | first4=Angela | last5=Filho | first5=Valdir Cechinel | last6=Yunes | first6=Rosendo A. | last7=Calixto | first7=João B. }}{{Cite journal | doi=10.1016/j.freeradbiomed.2009.05.035 | title=Sesquiterpene dialdehydes inhibit MSU crystal-induced superoxide production by infiltrating neutrophils in an in vivo model of gouty inflammation | journal=Free Radical Biology and Medicine | volume=47 | issue=5 | pages=616–621 | year=2009 | last1=Martin | first1=William John | last2=Herst | first2=Patries M. | last3=Chia | first3=Elizabeth W. | last4=Harper | first4=Jacquie L. | pmid=19500663 }}
Polygodial’s primary antifungal action is as a nonionic surfactant, disrupting the lipid-protein interface of integral proteins nonspecifically, denaturing their functional conformation. It is also likely that polygodial permeates by passive diffusion across the plasma membrane, and once inside the cells may react with a variety of intracellular compounds.{{Cite journal | doi=10.1002/ptr.1777 | title=Antibacterial activity of polygodial | journal=Phytotherapy Research | volume=19 | issue=12 | pages=1013–1017 | year=2005 | last1=Kubo | first1=Isao | last2=Fujita | first2=Ken-Ichi | last3=Lee | first3=Sang Hwa | last4=Ha | first4=Tae Joung | pmid=16372365 | s2cid=30377678 }}
It is also an insecticide with antifeedant properties, which causes insects to starve.
References
{{Transient receptor potential channel modulators}}