poncirin

{{one source|date=October 2014}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 412210452

| Name = Poncirin

| ImageFile = Poncirin.svg

| ImageSize = 300px

| ImageName = Poncirin

| IUPACName = (2S)-5-Hydroxy-4′-methoxy-7-[α-L-rhamnopyranosyl-(1→2)-β-D-glucopyranosyloxy]flavan-4-one

| SystematicName = (2S)-7-{[(2S,3R,4S,5S,6R)-4,5-Dihydroxy-6-(hydroxymethyl)-3-{[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy}oxan-2-yl]oxy}-5-hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-4H-1-benzopyran-4-one

| OtherNames = Isosakuranetin-7-neohesperidoside

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 14941-08-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8MUY4P95B4

| EINECS =

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 66773

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 451050

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 390894

| SMILES = C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=CC(=C4C(=O)C[C@H](OC4=C3)C5=CC=C(C=C5)OC)O)CO)O)O)O)O)O

| InChI = 1/C28H34O14/c1-11-21(32)23(34)25(36)27(38-11)42-26-24(35)22(33)19(10-29)41-28(26)39-14-7-15(30)20-16(31)9-17(40-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-8,11,17,19,21-30,32-36H,9-10H2,1-2H3/t11-,17-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1

| InChIKey = NLAWPKPYBMEWIR-SKYQDXIQBA

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C28H34O14/c1-11-21(32)23(34)25(36)27(38-11)42-26-24(35)22(33)19(10-29)41-28(26)39-14-7-15(30)20-16(31)9-17(40-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-8,11,17,19,21-30,32-36H,9-10H2,1-2H3/t11-,17-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = NLAWPKPYBMEWIR-SKYQDXIQSA-N

| PubChem = 442456

}}

|Section2={{Chembox Properties

| C=28 | H=34 | O=14

| MeltingPt =

| Solvent =

| SolubleOther =

}}

}}

Poncirin is the 7-O-neohesperidoside of isosakuranetin. Poncirin can be extracted from trifoliate orange (Poncirus trifoliata).{{cite journal | doi = 10.1248/bpb.22.422 | title = Anti-Helicobacter pylori Activity of the Metabolites of Poncirin from Poncirus trifoliata by Human Intestinal Bacteria | date = 1999 | last1 = Kim | first1 = Dong-Hyun | last2 = Bae | first2 = Eun-Ah | last3 = Han | first3 = Myung Joo | journal = Biological and Pharmaceutical Bulletin | volume = 22 | issue = 4 | pages = 422–424 | pmid = 10328566 }}