poriol

{{one source|date=October 2014}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 449572983

| Name = Poriol

| ImageFile = Poriol.svg

| ImageName = Chemical structure of poriol

| IUPACName = (2S)-5,7-Dihydroxy-2-(4-hydroxyphenyl)-6-methyl-2,3-dihydrochromen-4-one

| OtherNames = (2S)-4',5,7-Trihydroxy-6-methylflavanone

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 14348-16-4

| CASNoOther =

| PubChem = 92258068

| SMILES = CC1=C(C2=C(C=C1O)O[C@@H](CC2=O)C3=CC=C(C=C3)O)O

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 57643118

| InChI = InChI=1S/C16H14O5/c1-8-11(18)6-14-15(16(8)20)12(19)7-13(21-14)9-2-4-10(17)5-3-9/h2-6,13,17-18,20H,7H2,1H3/t13-/m0/s1

| InChIKey = SLFZBNOERHGNMI-ZDUSSCGKSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=16 | H=14 | O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

}}

Poriol is a C-methylated flavanone, a type of flavonoid. It is found in Pseudotsuga menziesii (Douglas fir) in reaction to infection by Poria weirii.New C-methylflavanones from Douglas-fir. G.M. Barton, Phytochemistry, Volume 11, Issue 1, January 1972, pp. 426-429, {{doi|10.1016/S0031-9422(00)90036-0}}