potassium canrenoate

{{Short description|Pharmaceutical drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464211168

| IUPAC_name = potassium 3-[(8R,9S,10R,13S,14S,17R)-
17-hydroxy-10,13-dimethyl-3-oxo-2,8,9,
11,12,14,15,16-octahydro-1H-cyclopenta[a]
phenanthren-17-yl]propanoate

| image = Potassium canrenoate.svg

| width = 250px

| tradename =

| Drugs.com = {{drugs.com|international|potassium-canrenoate}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intravenous

| bioavailability =

| protein_bound =

| metabolism = Hepatic

| elimination_half-life =

| excretion = Renal and fecal

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 2181-04-6

| ATC_prefix = C03

| ATC_suffix = DA02

| PubChem = 23671691

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB09015

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1371200

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 570975

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = M671F9NLEA

| synonyms = SC-14266

| chemical_formula =

| C=22 | H=29 | K=1 | O=4

| smiles = [K+].[O-]C(=O)CC[C@]3(O)CC[C@H]2[C@@H]4/C=C\C1=C\C(=O)CC[C@@]1([C@H]4CC[C@@]23C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H30O4.K/c1-20-9-5-15(23)13-14(20)3-4-16-17(20)6-10-21(2)18(16)7-11-22(21,26)12-8-19(24)25;/h3-4,13,16-18,26H,5-12H2,1-2H3,(H,24,25);/q;+1/p-1/t16-,17+,18+,20+,21+,22-;/m1./s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JTZQCHFUGHIPDF-RYVBEKKQSA-M

}}

Potassium canrenoate (INN, JAN) or canrenoate potassium (USAN) (brand names Venactone, Soldactone), also known as aldadiene kalium,{{cite book| vauthors = Selye H |title=Hormones and Resistance: Part 1 and|url=https://books.google.com/books?id=NdvnCAAAQBAJ&pg=PA186|date=17 April 2013|publisher=Springer Science & Business Media|isbn=978-3-642-65192-2|pages=186–}} the potassium salt of canrenoic acid, is an aldosterone antagonist of the spirolactone group.{{cite book| vauthors = Hill RA, Makin HL, Kirk DN, Murphy GM |title=Dictionary of Steroids|url=https://books.google.com/books?id=qw5X0NK1A90C&pg=PA656|date=23 May 1991|publisher=CRC Press|isbn=978-0-412-27060-4|pages=656–}} Like spironolactone, it is a prodrug, and is metabolized to active canrenone in the body.{{cite book| vauthors = Burger A, Wolff ME |title=Burger's Medicinal Chemistry and Drug Discovery: Therapeutic agents|url=https://books.google.com/books?id=iLvwAAAAMAAJ|year=1996|publisher=Wiley|isbn=978-0-471-57557-3}}{{cite book| vauthors = Waldmann C, Soni N, Rhodes A | chapter = Diurectics and the Critical Ill |title=Oxford Desk Reference: Critical Care| chapter-url = https://books.google.com/books?id=eLqMpXfAlEcC&pg=PA187|date=27 November 2008|publisher=OUP Oxford|isbn=978-0-19-922958-1|pages=187–}}

Potassium canrenoate is notable in that it is the only clinically used antimineralocorticoid which is available for parenteral administration (specifically intravenous){{cite book| vauthors = Santambrogio R, Barabino M, Opocher E | chapter = Non-resection: Radiofrequency Ablation, Cryo, Microwave | veditors = Bonjer HJ |title=Surgical Principles of Minimally Invasive Procedures: Manual of the European Association of Endoscopic Surgery (EAES)|chapter-url=https://books.google.com/books?id=tAImDwAAQBAJ&pg=PA136|date=21 June 2017|publisher=Springer|isbn=978-3-319-43196-3|pages=136–}} as opposed to oral administration.{{cite journal | vauthors = Kolkhof P, Bärfacker L | title = 30 YEARS OF THE MINERALOCORTICOID RECEPTOR: Mineralocorticoid receptor antagonists: 60 years of research and development | journal = The Journal of Endocrinology | volume = 234 | issue = 1 | pages = T125–T140 | date = July 2017 | pmid = 28634268 | pmc = 5488394 | doi = 10.1530/JOE-16-0600 }}

In the UK, it is unlicensed and only used for short term diuresis in oedema or heart failure in neonates or children under specialist initiation and monitoring.

See also

References

{{Reflist|2}}

{{Diuretics}}

{{Antimineralocorticoids}}

{{Antiandrogens}}

{{Mineralocorticoidics}}

{{Progestogenics}}

{{Androgenics}}

Category:11β-Hydroxylase inhibitors

Category:Antimineralocorticoids

Category:CYP17A1 inhibitors

Category:Pregnanes

Category:Potassium compounds

Category:Prodrugs

Category:Progestogens

Category:Spirolactones

Category:Steroidal antiandrogens

{{cardiovascular-drug-stub}}