potassium erythorbate

{{More citations needed|date=November 2022}}

{{chembox

| verifiedrevid = 428737731

| Reference =

| Name = Potassium erythorbate

| ImageFile = Potassium erythorbate.png

| ImageSize = 150px

| ImageName = Potassium erythorbate

| IUPACName = Potassium 5-(1,2-dihydroxyethyl)-3-hydroxy -4-oxo-furan-2-olate

| OtherNames = Erythorbic acid, potassium salt; E317

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 17175-66-5

| ChemSpiderID = 30647045

| EINECS = 239-432-1

| PubChem = 102218423

| SMILES = [K+].[O-]C=1[C@H](OC(=O)C=1O)[C@H](O)CO

| StdInChI=1S/C6H8O6.K/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-10H,1H2;/q;+1/p-1/t2-,5-;/m1./s1

| StdInChIKey = CONVKSGEGAVTMB-RKJRWTFHSA-M

}}

| Section2 = {{Chembox Properties

| Formula = C₆H₇KO₆

| MolarMass = 214.22 g/mol

| Appearance =

| Density =

| Solubility =

| MeltingPt =

| BoilingPt =

}}

| Section7 = {{Chembox Hazards

| ExternalMSDS =

| MainHazards =

}}

}}

Potassium erythorbate (C₆H₇KO₆){{Cite web |last=PubChem |title=Potassium erythorbate |url=https://pubchem.ncbi.nlm.nih.gov/compound/102218423 |access-date=2022-11-28 |website=pubchem.ncbi.nlm.nih.gov |language=en}} is a food additive. Chemically, it is the potassium salt of erythorbic acid. As an antioxidant structurally related to vitamin C, it helps improve flavor stability and prevents the formation of carcinogenic nitrosamines.