potassium gluconate
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 464211745
| drug_name =
| type =
| IUPAC_name = Potassium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate
| image = Potassium gluconate.svg
| alt =
| caption =
| image2 = Potassium-gluconate-3D-balls-ionic.png
| tradename =
| Drugs.com = {{drugs.com|CDI|potassium_gluconate}}
| MedlinePlus = a601072
| licence_EU =
| licence_US =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 299-27-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 12H3K5QKN9
| ATC_prefix = A12
| ATC_suffix = BA05
| PubChem = 16760467
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| DrugBank =
| ChemSpiderID = 8931
| C = 6
| H = 11
| K = 1
| O = 7
| smiles = [K+].[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H12O7.K/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = HLCFGWHYROZGBI-JJKGCWMISA-M
| melting_point = 180
| melting_notes = (decomposes)
| solubility =
}}
Potassium gluconate is the potassium salt of the conjugate base of gluconic acid. It is also referred to as 2,3,4,5,6-pentahydroxycaproic acid potassium salt, D-gluconic acid potassium salt, or potassium D-gluconate.{{cite web|url=http://www.sigmaaldrich.com/catalog/search?interface=Product%20Name&term=potassium+gluconate |title=Product Name potassium gluconate |publisher=Sigma-Aldrich |date= |accessdate=2013-03-09}}
It contains 16.69% elemental potassium by mass. Thus 5.99 g of potassium gluconate contains 1 g of potassium.
It has a density of 1.73 g/cm3.{{cite web|url=http://www.wolframalpha.com/input/?i=potassium+gluconate |title=Potassium gluconate |publisher=Wolfram Alpha |date= |accessdate=2013-04-21}}
Dietary uses
Potassium gluconate is used as a mineral supplement and sequestrant. It is sold over-the-counter as tablets or capsules providing up to 593 mg of potassium gluconate, thereby containing 99 mg or 2.53 milliequivalents of elemental potassium. This is the permissible upper limit for each tablet or capsule of over-the-counter potassium supplements sold in the US. Potassium gluconate is also sold over-the-counter as bulk powder.
As a food additive, potassium gluconate is used as an acidity regulator and yeast food.{{cite web |url=http://www.fao.org/fileadmin/user_upload/jecfa_additives/docs/Monograph1/Additive-337.pdf |title=Potassium Gluconate |author=Joint FAO/WHO Expert Committee on Food Additives |date= |website= |publisher= |access-date=28 November 2018}}{{cite web |url=http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4660 |title=Potassium Gluconate |author=Joint FAO/WHO Expert Committee on Food Additives |date= |website=Evaluations of the Joint FAO/WHO Expert Committee on Food Additives (JECFA) |publisher=World Health Organization |access-date=28 November 2018}} It is known as E number reference E577.
=Safety=
Its oral median lethal dose (LD50) in rats is 10.38 g/kg.{{cite web|url=http://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=US&language=en&productNumber=P1847&brand=SIAL&PageToGoToURL=http%3A%2F%2Fwww.sigmaaldrich.com%2Fcatalog%2Fsearch%3Finterface%3DProduct%2520Name%26term%3DPotassium%2Bgluconate%26lang%3Den%26region%3DUS%26focus%3Dproduct%26N%3D220003048%2B219853269%2B219853286%26mode%3Dmode%2520matchpartialmax |title=MSDS - P1847 |publisher=Sigma-Aldrich |date= |accessdate=2013-04-21}} This is not an indicator of a safe oral daily dose in rats or humans.
References
{{Reflist}}
External links
- [https://www.drugs.com/mtm/potassium-gluconate.html Potassium gluconate medical facts] from Drugs.com
- [http://www.wolframalpha.com/input/?i=potassium+gluconate Potassium gluconate] on Wolfram Alpha
{{Mineral supplements}}