potassium lactate

{{redirect|E326|the locomotive|FS Class E326}}

{{Chembox

| Verifiedfields = changed

| verifiedrevid = 477512901

| ImageFile = Potassium lactate.svg

| IUPACName = Potassium 2-hydroxypropanoate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 996-31-6

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 61248

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 276897E67U

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1200664

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 55189

| SMILES = [K+].[O-]C(=O)C(O)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI=1S/C3H6O3.K/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PHZLMBHDXVLRIX-UHFFFAOYSA-M

}}

|Section2={{Chembox Properties

| Formula = C₃H₅KO₃

| MolarMass = 128.168

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section7={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = B05

| ATCCode_suffix = XA15

}}

}}

Potassium lactate is a compound with formula KC₃H₅O₃. It is the potassium salt of lactic acid and appears as a clear, hygroscopic, syrupy liquid suspension that is typically 60% solids.{{Cite web |date=17 February 2015 |title=Lactic Acid, Sodium Lactate, and Potassium Lactate Handling/Processing |url=https://www.ams.usda.gov/sites/default/files/media/Lactic%20Acid%20and%20Lactates%20TR%2002-17-15%20Final.pdf |access-date=5 December 2023 |website=USDA Agricultural Marketing Service}} The substance can be concentrated to contain up to 78% solids.PURASAL http://www.purac.com/EN/Food/Brands/Potassium_lactate.aspx {{Webarchive|url=https://web.archive.org/web/20140221092834/http://www.purac.com/EN/Food/Brands/Potassium_lactate.aspx|date=2014-02-21}} It is produced by neutralizing lactic acid, which is fermented from a sugar source. It has E number E326.