pramiconazole

{{Short description|Chemical compound}}

{{More citations needed|date=January 2021}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 366890982

| IUPAC_name = 1-{4-[4-(4-{[(2R,4S)-2-(2,4-difluorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1-yl]phenyl}-3-isopropylimidazolidin-2-one

| image = Pramiconazole.png

| width =

| image2 =

| width2 =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 219923-85-0

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem2 = 11411233

| PubChem = 3013050

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4SYH0R661F

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 175797

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 2281806

| synonyms =

| C=35 | H=39 | F=2 | N=7 | O=4

| SMILES = CC(C)N1CCN(C1=O)c2ccc(cc2)N3CCN(CC3)c4ccc(cc4)OC[C@H]5OC[C@](O5)(Cn6cncn6)c7ccc(cc7F)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C35H39F2N7O4/c1-25(2)43-17-18-44(34(43)45)29-6-4-27(5-7-29)40-13-15-41(16-14-40)28-8-10-30(11-9-28)46-20-33-47-22-35(48-33,21-42-24-38-23-39-42)31-12-3-26(36)19-32(31)37/h3-12,19,23-25,33H,13-18,20-22H2,1-2H3/t33-,35+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = AEKNYBWUEYNWMJ-QWOOXDRHSA-N

}}

Pramiconazole is a triazole antifungal which was under development by Barrier Therapeutics for the treatment of acute skin and mucosal fungal infections but was never marketed.{{Cite web|url=https://adisinsight.springer.com/drugs/800020810|title=Pramiconazole - AdisInsight}}{{cite journal | vauthors = Geria AN, Scheinfeld NS | title = Pramiconazole, a triazole compound for the treatment of fungal infections | journal = IDrugs: The Investigational Drugs Journal | volume = 11 | issue = 9 | pages = 661–70 | date = September 2008 | pmid = 18763217 | doi = | url = }}