pranlukast

{{Short description|Chemical compound}}

{{Infobox drug

| Watchedfields = changed

| verifiedrevid = 464213227

| IUPAC_name = N-[4-oxo-2-(1H-tetrazol-5-yl)-4H-chromen-8-yl]-4-(4-phenylbutoxy)benzamide

| image = Pranlukast.svg

| tradename = Onon (オノン)

| Drugs.com = {{drugs.com|international|pranlukast}}

| pregnancy_category =

| legal_status =

| routes_of_administration = Oral

| bioavailability =

| metabolism = Hepatic (mainly CYP3A4){{cite journal | vauthors = Nakade S, Ueda S, Ohno T, Nakayama K, Miyata Y, Yukawa E, Higuchi S | title = Population pharmacokinetics of pranlukast hydrate dry syrup in children with allergic rhinitis and bronchial asthma | journal = Drug Metabolism and Pharmacokinetics | volume = 21 | issue = 2 | pages = 133–139 | date = April 2006 | pmid = 16702733 | doi = 10.2133/dmpk.21.133 | url = http://www.jstage.jst.go.jp/article/dmpk/21/2/21_133/_article | url-status = dead | archive-url = https://web.archive.org/web/20080917120315/http://www.jstage.jst.go.jp/article/dmpk/21/2/21_133/_article | archive-date = 2008-09-17 }}

| elimination_half-life = 1.5 hours

| excretion =

| IUPHAR_ligand = 3634

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 103177-37-3

| ATC_prefix = R03

| ATC_suffix = DC02

| PubChem = 4887

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01411

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4718

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = TB8Z891092

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 21333

| C=27 | H=23 | N=5 | O=4

| smiles = O=C(Nc2cccc3c(=O)cc(c1nn[nH]n1)oc23)c5ccc(OCCCCc4ccccc4)cc5

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C27H23N5O4/c33-23-17-24(26-29-31-32-30-26)36-25-21(23)10-6-11-22(25)28-27(34)19-12-14-20(15-13-19)35-16-5-4-9-18-7-2-1-3-8-18/h1-3,6-8,10-15,17H,4-5,9,16H2,(H,28,34)(H,29,30,31,32)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NBQKINXMPLXUET-UHFFFAOYSA-N

}}

Pranlukast (brand name Onon, オノン) is a cysteinyl leukotriene receptor-1 antagonist. This drug works similarly to Merck & Co.'s montelukast (Singulair). It is widely used in Japan.

Medications of this class, which go under a variety of names according to whether one looks at the American, British or European system of nomenclature, have as their primary function the antagonism of bronchospasm caused, principally in asthmatics, by an allergic reaction to accidentally or inadvertently encountered allergens.{{cite journal | vauthors = Singh RK, Tandon R, Dastidar SG, Ray A | title = A review on leukotrienes and their receptors with reference to asthma | journal = The Journal of Asthma | volume = 50 | issue = 9 | pages = 922–931 | date = November 2013 | pmid = 23859232 | doi = 10.3109/02770903.2013.823447 | s2cid = 11433313 }}

Medications of this group are normally used as an adjunct to the standard therapy of inhaled steroids with inhaled long- and/or short-acting beta-agonists. There are several similar medications in the group; all appear to be equally effective. Pranlukast is also reported as potential inhibitor of Mycobacterium tuberculosis infection in experimental models.{{cite journal | vauthors = Mishra A, Mamidi AS, Rajmani RS, Ray A, Roy R, Surolia A | title = An allosteric inhibitor of Mycobacterium tuberculosis ArgJ: Implications to a novel combinatorial therapy | journal = EMBO Molecular Medicine | volume = 10 | issue = 4 | pages = e8038 | date = April 2018 | pmid = 29483133 | pmc = 5887547 | doi = 10.15252/emmm.201708038 }}