previtamin D3

{{DISPLAYTITLE:Previtamin D3}}

{{Chembox

| Name = Previtamin D3

| ImageFile = Previtamin D3.svg

| ImageClass = skin-invert-image

| ImageFile_Ref = {{Chemboximage|correct|??}}

| ImageName = Stereo skeletal formula of previtamin D3 ((1R)-1-ol, (Z)-en, (1R,3aR,7aR)-7a-meth,-1-hept,-3a-hydro, (2R)-2-yl)

| IUPACName = (3S,6Z)-9,10-Secocholesta-5(10),6,8-trien-3-ol

| SystematicName = (1S)-4-Methyl-3-[(Z)-2-{(1R,3aR,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2,3,3a,6,7,7a-hexahydro-1H-inden-4-yl}ethen-1-yl]cyclohex-3-en-1-ol

| OtherNames = Previtamin D3

|Section1={{Chembox Identifiers

| CASNo = 1173-13-3

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo1 = 17592-07-3

| CASNo1_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = HDA46400N5

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = 6RR0I9PK8W

| PubChem = 86590

| PubChem1 = 6178113

| PubChem1_Comment = (E)-en

| PubChem2 = 25245851

| PubChem2_Comment = (1S)-1-ol, (Z)-en, (2R)-2-yl

| PubChem3 = 11485943

| PubChem3_Comment = (1S)-1-ol, (E)-en, (1R,7aR)-7a-meth,-1-hept, (2R)-2-yl

| PubChem4 = 11199982

| PubChem4_Comment = (1S)-1-ol, (Z)-en, (1R,7aR)-7a-meth,-1-hept, (2R)-2-yl

| ChemSpiderID = 78098

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID1 = 4832524

| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID1_Comment = (E)-en

| ChemSpiderID2 = 9660762

| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID2_Comment = (1S)-1-ol, (E)-en, (1R,7aR)-7a-meth,-1-hept, (2R)-2-yl

| ChemSpiderID3 = 9375051

| ChemSpiderID3_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID3_Comment = (1S)-1-ol, (Z)-en, (1R,7aR)-7a-meth,-1-hept, (2R)-2-yl

| EINECS = 241-561-3

| MeSHName = Previtamin+D(3)

| SMILES = CC(C)CCCC(C)C1CCC2C(C=CC3=C(C)CCC(O)C3)=CCCC12C

| StdInChI = 1S/C27H44O/c1-19(2)8-6-9-21(4)25-15-16-26-22(10-7-17-27(25,26)5)12-13-23-18-24(28)14-11-20(23)3/h10,12-13,19,21,24-26,28H,6-9,11,14-18H2,1-5H3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = YUGCAAVRZWBXEQ-UHFFFAOYSA-N

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

}}

|Section2={{Chembox Properties

| C=27 | H=44 | O=1

}}

}}

Previtamin D3 is an intermediate in the production of cholecalciferol (vitamin D3).

It is formed by the action of UV light, most specifically UVB light of wavelengths between 295 and 300 nm, acting on 7-dehydrocholesterol in the epidermal layers of the skin.{{cite journal | vauthors = MacLaughlin JA, Anderson RR, Holick MF | title = Spectral character of sunlight modulates photosynthesis of previtamin D3 and its photoisomers in human skin | journal = Science | volume = 216 | issue = 4549 | pages = 1001–3 | date = May 1982 | pmid = 6281884 | doi = 10.1126/science.6281884 | bibcode = 1982Sci...216.1001M }}{{cite journal | vauthors = Webb AR | title = Who, what, where and when-influences on cutaneous vitamin D synthesis | journal = Progress in Biophysics and Molecular Biology | volume = 92 | issue = 1 | pages = 17–25 | date = September 2006 | pmid = 16766240 | doi = 10.1016/j.pbiomolbio.2006.02.004 | doi-access = free }}{{cite journal | vauthors = Pope SJ, Holick MF, Mackin S, Godar DE | title = Action spectrum conversion factors that change erythemally weighted to previtamin D3-weighted UV doses | journal = Photochemistry and Photobiology | volume = 84 | issue = 5 | pages = 1277–83 | year = 2008 | pmid = 18513232 | doi = 10.1111/j.1751-1097.2008.00373.x | s2cid = 23246616 | url = https://zenodo.org/record/848826 | doi-access = free }}

The B ring of the steroid nucleus structure is broken open, making a secosteroid. This then undergoes spontaneous isomerization into cholecalciferol, the prohormone of the active form of vitamin D, calcitriol.

The synthesis of previtamin D3 is blocked effectively by sunscreens.{{cite journal | vauthors = Sayre RM, Dowdy JC | title = Darkness at noon: sunscreens and vitamin D3 | journal = Photochemistry and Photobiology | volume = 83 | issue = 2 | pages = 459–63 | year = 2007 | pmid = 17115796 | doi = 10.1562/2006-06-29-RC-956 | s2cid = 23767593 }}

Interactive pathway map

{{VitaminDSynthesis_WP1531|highlight=Previtamin_D3}}

References