propargite

{{Chembox

| ImageFile = Propargite Structural Formula V.1.svg

| ImageSize = 240

| ImageAlt = Skeletal formula

| ImageFile1 = Propargite-3D-spacefill.png

| ImageSize1 = 240

| ImageAlt1 = Space-filling model

| IUPACName = 2-(4-tert-butylphenoxy)cyclohexyl prop-2-yne-1-sulfonate

| OtherNames = Omite, Comite, Uniroyal D014

| Reference =

{{Citation

| last = Lide

| first = David R.

| author-link =

| publication-date =

| year = 1998

| title = Handbook of Chemistry and Physics

| edition = 87

| volume =

| series =

| location = Boca Raton, Florida

| place =

| publisher = CRC Press

| id =

| isbn = 978-0-8493-0594-8

| doi =

| oclc =

| pages = 3–482

| url =

}}{{cite web |url=http://pmep.cce.cornell.edu/profiles/insect-mite/mevinphos-propargite/propargite/insect-prof-propargite.html |title= propargite (Omite, Comite) Chemical Fact Sheet 9/86|last1= |first1= |last2= |first2= |date=1986-09-30 |website= |publisher= Cornell University |access-date=2009-12-02}}

|Section1={{Chembox Identifiers

| CASNo = 2312-35-8

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 30M429ANKL

| PubChem = 4936

| ChemSpiderID = 4767

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C18602

| ChEMBL = 1416084

| SMILES = O=S(OCC#C)OC2CCCCC2Oc1ccc(cc1)C(C)(C)C

| InChI =1S/C19H26O4S/c1-5-14-21-24(20)23-18-9-7-6-8-17(18)22-16-12-10-15(11-13-16)19(2,3)4/h1,10-13,17-18H,6-9,14H2,2-4H3

}}

|Section2={{Chembox Properties

| C=19 | H=26 | O=4 | S=1

| Appearance = dark amber viscous liquid

| Density = 1.10 g/cm³

| MeltingPt =

| BoilingPt =

| Solubility = 0.5 ppm

| SolubleOther = miscible in organic solvents

}}

|Section7={{Chembox Hazards

| ExternalSDS = [http://pmep.cce.cornell.edu/profiles/insect-mite/mevinphos-propargite/propargite/insect-prof-propargite.html Cornell University]

| NFPA-H =

| NFPA-F =

| NFPA-R =

| HPhrases =

| PPhrases =

| GHS_ref =

| FlashPt =

}}

}}

Propargite (IUPAC name 2-(4-tert-butylphenoxy)cyclohexyl prop-2-yne-1-sulfonate, trade names Mitex, Omite and Comite) is a pesticide used to kill mites (an acaricide). It acts through inhibition of mitochondrial ATP synthase, and is in IRAC group 12C.{{Cite journal |last=Kadir |first=Habsah A. |last2=Knowles |first2=Charles O. |date=1 June 1991 |title=, Inhibition of ATP Dephosphorylation by Acaricides with Emphasis on the Anti-ATPase Activity of the Carbodiimide Metabolite of Diafenthiuron |doi=10.1093/jee/84.3.801 |journal=Journal of Economic Entomology |volume=84 |issue=3 |pages=801–805}} Symptoms of excessive exposure are eye and skin irritation, and possibly sensitization. It is highly toxic to amphibians, fish, and zooplankton, as well as having potential carcinogenity.{{Cite web | url=http://www.epa.gov/iris/subst/0296.htm | title=Integrated Risk Information System| date=2013-03-15}}