propetamphos
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name =
| image = Propetamphos.svg
| width = 225
| image2 =
| width2 =
| tradename = Propetamphos
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 31218-83-4
| CAS_supplemental =
| ATCvet = Yes
| ATC_prefix = P53
| ATC_suffix = AF09
| ATC_supplemental =
| PubChem = 5372405
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 4939080
| UNII = G4A07F635U
| KEGG = C18669
| ChEBI = 38864
| ChEMBL = 1875667
| DTXSID = DTXSID7032470
| synonyms = (E)-1-Methylethyl 3-[{(ethylamino)methoxyphosphinothioly}oxy]-2-butenoate
| C=10 | H=20 | N=1| O=4|P=1|S=1
| SMILES = O([P@@](NCC)(OC)=S)\C(=C/C(OC(C)C)=O)C
| StdInChI_Ref =
| StdInChI = 1S/C10H20NO4PS/c1-6-11-16(17,13-5)15-9(4)7-10(12)14-8(2)3/h7-8H,6H2,1-5H3,(H,11,17)/b9-7-
| StdInChIKey_Ref =
| StdInChIKey = BZNDWPRGXNILMS-CLFYSBASSA-N
}}
Propetamphos is an insecticide (cockroaches, flies, ants, ticks, moths, fleas and mosquitoes) from the group of organophosphates, based on thiophosphoric acid ester.{{Cite web | url=http://pmep.cce.cornell.edu/profiles/extoxnet/metiram-propoxur/propetamphos-ext.html | archive-url = https://web.archive.org/web/20060524193250/http://pmep.cce.cornell.edu/profiles/extoxnet/metiram-propoxur/propetamphos-ext.html | archive-date = 24 May 2006 | title=Propetamphos | work = Extension Toxicology Network (EXTOXNET) | publisher = Cornell University | date = September 1993 }}{{cite book | vauthors = Kamrin MA | chapter = Chapter 5.2.21: Propetamphos | chapter-url = https://books.google.com/books?id=8IM_A0aTM6UC&pg=PA219 |title=Pesticide Profiles: Toxicity, Environmental Impact, and Fate |date=1997 |publisher=CRC/Lewis Publishers |location=Boca Raton, FL |isbn=978-1-4200-4922-0 |pages=217–219}}
The molecule with formula is C10H20NO4PS has a molecular weight of 281.311 g/mol.{{PubChem|5372405}}
References
{{Reflist}}