propetamphos

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name =

| image = Propetamphos.svg

| width = 225

| image2 =

| width2 =

| tradename = Propetamphos

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 31218-83-4

| CAS_supplemental =

| ATCvet = Yes

| ATC_prefix = P53

| ATC_suffix = AF09

| ATC_supplemental =

| PubChem = 5372405

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 4939080

| UNII = G4A07F635U

| KEGG = C18669

| ChEBI = 38864

| ChEMBL = 1875667

| DTXSID = DTXSID7032470

| synonyms = (E)-1-Methylethyl 3-[{(ethylamino)methoxyphosphinothioly}oxy]-2-butenoate

| C=10 | H=20 | N=1| O=4|P=1|S=1

| SMILES = O([P@@](NCC)(OC)=S)\C(=C/C(OC(C)C)=O)C

| StdInChI_Ref =

| StdInChI = 1S/C10H20NO4PS/c1-6-11-16(17,13-5)15-9(4)7-10(12)14-8(2)3/h7-8H,6H2,1-5H3,(H,11,17)/b9-7-

| StdInChIKey_Ref =

| StdInChIKey = BZNDWPRGXNILMS-CLFYSBASSA-N

}}

Propetamphos is an insecticide (cockroaches, flies, ants, ticks, moths, fleas and mosquitoes) from the group of organophosphates, based on thiophosphoric acid ester.{{Cite web | url=http://pmep.cce.cornell.edu/profiles/extoxnet/metiram-propoxur/propetamphos-ext.html | archive-url = https://web.archive.org/web/20060524193250/http://pmep.cce.cornell.edu/profiles/extoxnet/metiram-propoxur/propetamphos-ext.html | archive-date = 24 May 2006 | title=Propetamphos | work = Extension Toxicology Network (EXTOXNET) | publisher = Cornell University | date = September 1993 }}{{cite book | vauthors = Kamrin MA | chapter = Chapter 5.2.21: Propetamphos | chapter-url = https://books.google.com/books?id=8IM_A0aTM6UC&pg=PA219 |title=Pesticide Profiles: Toxicity, Environmental Impact, and Fate |date=1997 |publisher=CRC/Lewis Publishers |location=Boca Raton, FL |isbn=978-1-4200-4922-0 |pages=217–219}}

The molecule with formula is C10H20NO4PS has a molecular weight of 281.311 g/mol.{{PubChem|5372405}}

References