protokylol

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 4-[2-[[2-(1,3-Benzodioxol-5-yl)-1-methyl-ethyl]amino]-1-hydroxy-ethyl]benzene-1,2-diol

| image = Protokylol.svg

| tradename =

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 136-70-9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 4969

| ChemSpiderID = 4798

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8Y5Y4EEO2V

| ChEMBL = 1201273

| C=18 | H=21 | N=1 | O=5

| smiles = O1c2ccc(cc2OC1)CC(NCC(O)c3ccc(O)c(O)c3)C

}}

Protokylol (Ventaire) is a β-adrenergic receptor agonist used as a bronchodilator in Europe and the United States.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA894}}{{failed verification|date=February 2020}}

It is methylenedioxyphenyl-isoproterenol.

The Para-Methoxyamphetamine (PMA) analog is twice the potency as the tenamfetamine analog.{{cite journal| vauthors = Biel JH, Schwarz EG, Sprengeler EP, Leiser HA, Friedman HL |title=Bronchodilators, N-Substituted Derivatives of 1-(3',4'-Dihydroxyphenyl)-2-aminoethanol (Arterenol)|journal=Journal of the American Chemical Society|volume=76|issue=12|year=1954|pages=3149–3153|issn=0002-7863|doi=10.1021/ja01641a010}}