pseudohypericin

{{chembox

| verifiedrevid =

| ImageFile = Pseudohypericin2DACS.svg

| ImageSize =

| ImageAlt =

| ImageFile1 =

| ImageSize1 =

| ImageAlt1 =

| PIN=1,3,4,6,8,13-Hexahydroxy-10-(hydroxymethyl)-11-methylphenanthro[3,4,5,6-fghij]perylene-7,14-dione

| OtherNames=

|Section1={{Chembox Identifiers

| UNII_Ref =

| UNII = MQ0U4663ZO

| StdInChI = 1S/C30H16O9/c1-7-2-9(32)19-23-15(7)16-8(6-31)3-10(33)20-24(16)28-26-18(12(35)5-14(37)22(26)30(20)39)17-11(34)4-13(36)21(29(19)38)25(17)27(23)28/h2-5,31,34-39H,6H2,1H3

| StdInChIKey = NODGUBIGZKATOM-UHFFFAOYSA-N

| ChEMBL = 1614664

| EINECS = 611-335-2

| KEGG = C10392

| ChemSpiderID = 4445065

| 3DMet = B03886

| CASNo_Ref =

| CASNo= 55954-61-5

| PubChem= 4978

| ChEBI_Ref =

| ChEBI = 8605

| SMILES = CC1=CC(=O)C2=C(C3=C(C=C(C4=C3C5=C6C7=C(C1=C25)C(=CC(=O)C7=C(C8=C(C=C(C4=C86)O)O)O)CO)O)O)O

}}

|Section2={{Chembox Properties

| C=30 | H=16 | O=9

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

| LogP = 4.5

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Pseudohypericin is an aromatic polycyclic dione that is very closely related to hypericin. It is found most commonly in the St. John's wort family of plants, namely in Hypericum perforatum.{{Cite journal |doi = 10.1016/S0305-1978(00)00032-6 |title = Hypericin and pseudohypericin in some Hypericum species |journal = Biochemical Systematics and Ecology |volume = 29 |issue = 2 |pages = 171–178 |year = 2001 |last1 = Kitanov |first1 = Gerassim M. |pmid = 11106845 }} In preliminary studies in animal models, pseudohypericin has shown antiviral effects.{{cite journal | pmc = 281723 | doi = 10.1073/pnas.85.14.5230| title = Therapeutic agents with dramatic antiretroviral activity and little toxicity at effective doses: Aromatic polycyclic diones hypericin and pseudohypericin| journal = Proceedings of the National Academy of Sciences| volume = 85| issue = 14| pages = 5230–5234| year = 1988| last1 = Meruelo| first1 = D.| last2 = Lavie| first2 = G.| last3 = Lavie| first3 = D.| pmid = 2839837| bibcode = 1988PNAS...85.5230M| doi-access = free}}{{Cite journal | doi = 10.1016/0166-3542(91)90028-P | title = Antiviral activities of hypericin | journal = Antiviral Research | volume = 15 | issue = 2 | pages = 101–112 | year = 1991 | last1 = Hudson | first1 = J.B. | last2 = Lopez-Bazzocchi | first2 = I. | last3 = Towers | first3 = G.H.N. | pmid = 1650164 }} It may also contribute to the potential antidepressant effect of Hypericum perforatum extracts.{{Cite journal | doi = 10.1055/s-2006-957437 | title = Solubilized Hypericin and Pseudohypericin from Hypericum perforatum Exert Antidepressant Activity in the Forced Swimming Test3 | journal = Planta Medica | volume = 64 | issue = 4 | pages = 291–294 | year = 1998 | last1 = Butterweck | first1 = Veronika | last2 = Petereit | first2 = Frank | last3 = Winterhoff | first3 = Hilke | last4 = Nahrstedt | first4 = Adolf | pmid = 9619107 }}