psoromic acid

{{Chembox

| ImageFile = Psoromic acid.png

| ImageSize =

| ImageAlt =

| IUPACName = 10-Formyl-9-hydroxy-3-methoxy-4,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-1-carboxylic acid{{cite journal |title=Psoromic acid |journal=Pubchem.ncbi.NLM.nih.gov |url=https://pubchem.ncbi.nlm.nih.gov/compound/Psoromic-acid |language=en}}

| OtherNames = {{ubl

|4-Formyl-3-hydroxy-8-methoxy-1,9-dimethyl-11-oxo-11H-dibenzo[b,e][1,4]dioxepin-6-carboxylic acid

|Parellic acid

|NSC 92186

}}

| Section1 = {{Chembox Identifiers

| CASNo = 7299-11-8

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChEBI = 92074

| ChEMBL = 176570

| ChemSpiderID = 22185

| DTXSID = DTXSID70223264

| EINECS =

| PubChem = 23725

| UNII =

| StdInChI = 1S/C18H14O8/c1-7-4-11(20)10(6-19)15-13(7)18(23)26-14-8(2)12(24-3)5-9(17(21)22)16(14)25-15/h4-6,20H,1-3H3,(H,21,22)

| StdInChIKey = FUCWJKJZOHOLEO-UHFFFAOYSA-N

| SMILES = CC1=C(OC)C=C(C(O)=O)C(OC2=C3C(C)=CC(O)=C2C=O)=C1OC3=O

}}

| Section2 = {{Chembox Properties

| C=18 | H=14 | O=8

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Psoromic acid is a β-orcinol depsidone with the molecular formula C₁₈H₁₄O₈. Psoromic acid inhibits herpes simplex viruses type 1 and type 2.{{cite journal |last1=Hassan |first1=Sherif T. S. |last2=Šudomová |first2=Miroslava |last3=Berchová-Bímová |first3=Kateřina |last4=Šmejkal |first4=Karel |last5=Echeverría |first5=Javier |title=Psoromic Acid, a Lichen-Derived Molecule, Inhibits the Replication of HSV-1 and HSV-2, and Inactivates HSV-1 DNA Polymerase: Shedding Light on Antiherpetic Properties |journal=Molecules |date=11 August 2019 |volume=24 |issue=16 |pages=2912 |doi=10.3390/molecules24162912|pmid=31405197 |pmc=6720901 |doi-access=free }} Furthermore, it inhibits the RabGGTase.{{cite journal |last1=Deraeve |first1=Céline |last2=Guo |first2=Zhong |last3=Bon |first3=Robin S. |last4=Blankenfeldt |first4=Wulf |last5=DiLucrezia |first5=Raffaella |last6=Wolf |first6=Alexander |last7=Menninger |first7=Sascha |last8=Stigter |first8=E. Anouk |last9=Wetzel |first9=Stefan |last10=Choidas |first10=Axel |last11=Alexandrov |first11=Kirill |last12=Waldmann |first12=Herbert |last13=Goody |first13=Roger S. |last14=Wu |first14=Yao-Wen |title=Psoromic Acid is a Selective and Covalent Rab-Prenylation Inhibitor Targeting Autoinhibited RabGGTase |journal=Journal of the American Chemical Society |date=2 May 2012 |volume=134 |issue=17 |pages=7384–7391 |doi=10.1021/ja211305j|pmid=22480322 }} Psoromic acid occurs in antarctic lichens.{{cite book |last1=Sukumaran |first1=Swapna Thacheril |last2=Sugathan |first2=Shiburaj |last3=Abdulhameed |first3=Sabu |title=Plant Metabolites: Methods, Applications and Prospects |date=28 November 2020 |publisher=Springer Nature |isbn=978-981-15-5136-9 |page=278 |language=en}}