pyrrocaine

{{chembox

| Name = Pyrrocaine

| ImageFile = Pyrrocaine.svg

| PIN = N-(2,6-Dimethylphenyl)-2-(pyrrolidin-1-yl)acetamide

| OtherNames =

| Section1 = {{Chembox Identifiers

| UNII = 9D47L94CPW

| CASNo=2210-77-7

| PubChem=24361

| EINECS = 218-642-7

| ChemSpiderID = 22776

| KEGG = D05665

| ChEMBL = 1895219

| SMILES=Cc1cccc(c1NC(=O)CN2CCCC2)C

| StdInChI = InChI=1S/C14H20N2O/c1-11-6-5-7-12(2)14(11)15-13(17)10-16-8-3-4-9-16/h5-7H,3-4,8-10H2,1-2H3,(H,15,17)

| StdInChIKey = OYCGKECKIVYHTN-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=14 | H=20 | N=2 | O=1

| MolarMass=232.327

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

| Section3 = {{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

| Section4 =

| Section5 =

| Section6 =

| Watchedfields = changed

}}

Pyrrocaine is a local anesthetic drug. The cogency of pyrrocaine is equivalent to lidocaine in blocking the motor nerve and sensory. Pyrrocaine was proven to be somewhat harmless compared to lidocaine. No signs of methemoglobinemia was found while observing. It was considered unsafe for acute porphyria treatment. No evidence is found that it is profitly used now.{{Cite web|url=https://drugs.ncats.io/substances?facet=Primary%20Target/5-aminolevulinate%20synthase,%20nonspecific,%20mitochondrial|title=NCATS Inxight: Drugs|website=drugs.ncats.io|language=en|access-date=2018-08-07}}

History

In the 1960s it was most of the time used as a nerve blocker dental anesthetic and dentists recommended it due to its fast commencement.

Adverse effects

Pyrrocane has very similar side effects on blood pressure and heart rate compared to lidocaine.{{Cite book|url=https://books.google.com/books?id=WstOAQAAIAAJ&q=Pyrrocaine+adverse+effects|title=Annals of Dentistry|date=1983|publisher=New York Academy of Dentistry|language=en}}

Synthesis

Selfsame as lidocaine, albeit interposing pyrrolidine for diethylamine.

File:Pyrrocaine synthesis.svg|inventor1-last=Schlesinger|inventor1-first=Albert|inventor2-last=Gordon|inventor2-first=Samuel M.}}{{Cite patent|country=GB|number=986993|pubdate=1965-03-24|title=Local anesthetics|assign1=Graham Chemical Corp.}}]]

Amide formation between 2,6-Dimethylaniline (1) and Chloroacetyl chloride (2) gives [1131-01-7] (3). Displacement of the remaining halogen by pyrrolidine (4) completed the synthesis of Pyrrocaine (5).

See also

References