pyrrolidinylthiambutene

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 449870661

| IUPAC_name = 1-(1-methyl-3,3-di-2-thienylprop-2-en-1-yl)pyrrolidine

| image = Pyrrolidinylthiambutene.svg

| image_class = skin-invert-image

| width = 180

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 785722-57-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 3SFP7VPW6S

| ATC_prefix = none

| ATC_suffix =

| PubChem = 57503828

| C=16 | H=19 | N=1 | S=2

| smiles = C2CCCN2C(C)C=C(c1sccc1)c3sccc3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H19NS2/c1-13(17-8-2-3-9-17)12-14(15-6-4-10-18-15)16-7-5-11-19-16/h4-7,10-13H,2-3,8-9H2,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PIJLUNXAEWABFK-UHFFFAOYSA-N

| melting_point = 167

| melting_high = 169

}}

Pyrrolidinylthiambutene is an opioid analgesic drug from the thiambutene family with around 3/4 of the potency of morphine.{{cite journal | vauthors = Adamson DW, Green AF | title = A new series of analgesics | journal = Nature | volume = 165 | issue = 4186 | pages = 122 | date = January 1950 | pmid = 15409854 | doi = 10.1038/165122a0 | bibcode = 1950Natur.165..122A | s2cid = 4190157 | doi-access = free }}{{cite journal | vauthors = Adamson DW, Duffin WM, Green AF | title = Dithienylbutylamines as analgesics | journal = Nature | volume = 167 | issue = 4239 | pages = 153–4 | date = January 1951 | pmid = 14806409 | doi = 10.1038/167153b0 | bibcode = 1951Natur.167..153A | s2cid = 4280042 }}{{cite journal | vauthors = Green AF | title = Analgesic and other properties of 3: 3-dithienylalkenylamines | journal = British Journal of Pharmacology and Chemotherapy | volume = 8 | issue = 1 | pages = 2–9 | date = March 1953 | pmid = 13066683 | pmc = 1509239 | doi = 10.1111/j.1476-5381.1953.tb00739.x }} It would be considered an illegal controlled substance analogue in some countries such as the US, Australia and New Zealand, but is legal in countries not possessing a controlled-substances-analog-act equivalent.