quaterpyridine

{{Chembox

| ImageFile = 2,2' 6',2 6,2-quaterpyridine.svg

| ImageSize =

| ImageAlt =

| IUPACName = 2,2':6',2:6,2'''-Quaterpyridine

| OtherNames =

|Section1={{Chembox Identifiers

| index1_label = 2,2':6',2:6,2'''

| CASNo1 = 4392-83-0

| ChemSpiderID = 9051697

| PubChem = 10876425

| SMILES1 = C1=CC(=NC=C1)C2=CC=CC(=N2)C3=CC=CC(=N3)C4=CC=CC=N4

| StdInChI=1S/C20H14N4/c1-3-13-21-15(7-1)17-9-5-11-19(23-17)20-12-6-10-18(24-20)16-8-2-4-14-22-16/h1-14H

| StdInChIKey = SSZWMEZKBBAJLB-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=20|H=14|N=4

| MolarMass =

| Appearance = white solid

| Density =

| MeltingPtC = 219-220

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Quaterpyridine refers to a family of pyridine derivatives with the formula (NC₅H₄-C₅H₃N)₂. These compounds can also be viewed as bipyridine decorated with two pyridyl substituents. Several isomers are known. All are colorless solids. One particular isomer, 2,2':6',2:6,2'''-quaterpyridine, a derivative of 2,2'-bipyridine has attracted interest because it is a potential tetradentate ligand in coordination chemistry.{{cite journal |doi=10.1021/acs.chemrev.6b00377|title=Quaterpyridines as Scaffolds for Functional Metallosupramolecular Materials |year=2016 |last1=Gorczyński |first1=Adam |last2=Harrowfield |first2=Jack M. |last3=Patroniak |first3=Violetta |last4=Stefankiewicz |first4=Artur R. |journal=Chemical Reviews |volume=116 |issue=23 |pages=14620–14674 |pmid=27960268 }}