quinestradol

{{Short description|Synthetic estrogen brand}}

{{Distinguish|Quinestrol}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8R,9S,13S,14S,16R,17R)-3-cyclopentyloxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-16,17-diol

| image = Quinestradiol_structure.png

| width = 250px

| tradename = Colpovis, Colpovister, Pentovis

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class = Estrogen; Estrogen ether

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 1169-79-5

| CAS_number_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 422L8173W8

| ATC_prefix = None

| ATC_suffix =

| PubChem = 14431

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 16735993

| synonyms = Quinestradiol; Quinestriol; Estriol 3-cyclopentyl ether; E3CPE

| C=23 | H=32 | O=3

| SMILES = CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)OC5CCCC5

| StdInChIKey = ODYKCPYPRCJXLY-PZORDLPLSA-N

| StdInChI = 1S/C23H32O3/c1-23-11-10-18-17-9-7-16(26-15-4-2-3-5-15)12-14(17)6-8-19(18)20(23)13-21(24)22(23)25/h7,9,12,15,18-22,24-25H,2-6,8,10-11,13H2,1H3/t18-,19-,20+,21-,22+,23+/m1/s1

}}

Quinestradol ({{abbrlink|INN|International Nonproprietary Name}}, {{abbrlink|BAN|British Approved Name}}) (brand names Colpovis, Colpovister, Pentovis), also known as quinestradiol or quinestriol, as well as estriol 3-cyclopentyl ether (E3CPE), is a synthetic estrogen and estrogen ether which is no longer marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA899|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=899–}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA905|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=905–}}{{cite book| vauthors = Crosignani PG, Paoletti R, Sarrel PM, Wenger NK |title=Women's Health in Menopause: Behaviour, Cancer, Cardiovascular Disease, Hormone Replacement Therapy|url=https://books.google.com/books?id=1PEkBAAAQBAJ&pg=PA245|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-1024-2|pages=245–}}{{cite book| vauthors = Seifer DB |title=Menopause: Endocrinology and Management|url=https://books.google.com/books?id=t0zMBgAAQBAJ&pg=PT161|date=27 July 1999|publisher=Springer Science & Business Media|isbn=978-1-59259-246-3|pages=161–}} It is the 3-cyclopentyl ether of estriol. The medication has been studied in the treatment of stress incontinence in elderly women, with effectiveness observed.