quinfamide

{{Short description|Chemical compound with anti-parasitic properties}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470603052

| IUPAC_name = [1-(2,2-dichloroacetyl)-3,4-dihydro-2H-quinolin-6-yl] furan-2-carboxylate

| image = Quinfamide.svg

| width = 170

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| ATC_prefix = None

| ATC_suffix =

| CAS_number = 62265-68-3

| PubChem = 71743

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 64787

| smiles = C1CC2=C(C=CC(=C2)OC(=O)C3=CC=CO3)N(C1)C(=O)C(Cl)Cl

| StdInChI = 1S/C16H13Cl2NO4/c17-14(18)15(20)19-7-1-3-10-9-11(5-6-12(10)19)23-16(21)13-4-2-8-22-13/h2,4-6,8-9,14H,1,3,7H2

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = SBJGFIXQRZOVTO-UHFFFAOYSA-N

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = O1ZB1046R1

| KEGG = D00641

| C=16 | H=13 | Cl=2 | N=1 | O=4

| melting_point =

| melting_high =

}}

Quinfamide is a drug that has anti-parasitic properties.{{cite journal | vauthors = Davila-Gutierrez CE, Vasquez C, Trujillo-Hernandez B, Huerta M | title = Nitazoxanide compared with quinfamide and mebendazole in the treatment of helminthic infections and intestinal protozoa in children | journal = The American Journal of Tropical Medicine and Hygiene | volume = 66 | issue = 3 | pages = 251–4 | date = March 2002 | pmid = 12139216 | doi = 10.4269/ajtmh.2002.66.251 | doi-access = free }}

Synthesis

Quinfamide is one of a relatively small family of antiamoebic compounds containing a dichloroacetamide function.{{cn|date=December 2022}}

File:Quinfamide synthesis.svg|title=1-(Halogenated-acetyl)-1,2,3,4-tetrahydro-6-quinolinols and esters thereof|inventor1-last=Bailey|inventor1-first=Denis Mahlon}}{{cite journal | vauthors = Bailey DM, Mount EM, Siggins J, Carlson JA, Yarinsky A, Slighter RG | title = 1-(Dichloroacetyl)-1,2,3,4-tetrahydro-6-quinolinol esters. New potent antiamebic agents | journal = Journal of Medicinal Chemistry | volume = 22 | issue = 5 | pages = 599–601 | date = May 1979 | pmid = 458814 | doi = 10.1021/jm00191a031 }}]]

The synthesis begins by amidation of 6-hydroxytetrahydroquinoline with dichloroacetyl chloride. The sequence is completed by acylation with 2-furoyl chloride.

References