radequinil

{{Short description|Chemical compound}}

{{Infobox drug

| IUPAC_name = 5-(3-methoxyphenyl)-3-(5-methyl-1,2,4-oxadiazol-3-yl)-1,6-naphthyridin-2(1H)-one

| image = Radequinil.svg

| CAS_number = 219846-31-8

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2G222T03EY

| ATC_prefix = None

| ATC_suffix =

| PubChem = 22714308

| ChemSpiderID = 11584471

| C=18 | H=14 | N=4 | O=3

| smiles = COc1cccc(c1)c3nccc2NC(=O)\C(=C/c23)c4nc(C)on4

| StdInChI = 1S/C18H14N4O3/c1-10-20-17(22-25-10)14-9-13-15(21-18(14)23)6-7-19-16(13)11-4-3-5-12(8-11)24-2/h3-9H,1-2H3,(H,21,23)

| StdInChIKey = JQOFKKWHXGQABB-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status =

| routes_of_administration =

}}

Radequinil (INN; AC-3933) is a cognitive enhancer which acts as a partial inverse agonist of the benzodiazepine site of the GABA_A receptor.{{cite journal | vauthors = Martocchia A, Falaschi P | title = Current Strategies of Therapy in Alzheimer's Disease | journal = The Open Neuropsychopharmacology Journal | volume = 1 | pages = 19–23 | year = 2008 | url = http://benthamscience.com/open/toneuroppj/articles/V001/19TONEUROPPJ.pdf| doi = 10.2174/1876523800801010019 |doi-access=free}} It was under development by Dainippon Sumitomo Pharma for the treatment of Alzheimer's disease and made it to phase II clinical trials but development seems to have been halted and it was never marketed.{{cite journal | vauthors = Pogacić V, Herrling P | title = List of drugs in development for neurodegenerative diseases. Update June 2007 | journal = Neuro-Degenerative Diseases | volume = 4 | issue = 6 | pages = 443–86 | year = 2007 | pmid = 17934328 | doi = 10.1159/000107705 | doi-access = free }}