radicinin

{{Chembox

| ImageFile = Radicinin.png

| ImageSize =

| ImageAlt =

| IUPACName = (2S,3S)-3-Hydroxy-2-methyl-7-[(E)-prop-1-enyl]-2,3-dihydropyrano[3,2-c]pyran-4,5-dione{{cite journal |title=Radicinin |journal=Pubchem.ncbi.NLM.nih.gov |url=https://pubchem.ncbi.nlm.nih.gov/compound/Radicinin#section=3D-Conformer |language=en}}

| OtherNames =

Stemphylone{{cite book |last1=Cole |first1=Richard J. |last2=Schweikert |first2=Milbra A. |last3=Jarvis |first3=Bruce B. |title=Handbook of Secondary Fungal Metabolites, 3-Volume Set |date=8 September 2003 |publisher=Elsevier |isbn=978-0-08-053381-0 |page=163 |language=en}}

| Section1 = {{Chembox Identifiers

| CASNo = 10088-95-6

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChEBI =

| ChEMBL =

| ChemSpiderID = 4529404

| DTXSID =

| EINECS =

| PubChem = 5381458

| UNII =

| StdInChI = 1S/C12H12O5/c1-3-4-7-5-8-9(12(15)17-7)11(14)10(13)6(2)16-8/h3-6,10,13H,1-2H3/b4-3+/t6-,10-/m0/s1

| StdInChIKey =SDKXGAICTNHFCN-DCJAWTJCSA-N

| SMILES = C/C=C/C1=CC2=C(C(=O)[C@H]([C@@H](O2)C)O)C(=O)O1

}}

| Section2 = {{Chembox Properties

| C=12 | H=12 | O=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Radicinin is a phytotoxin with the molecular formula C₁₂H₁₂O₅.{{cite journal |last1=Masi |first1=Marco |last2=Freda |first2=Fabrizio |last3=Sangermano |first3=Felicia |last4=Calabrò |first4=Viola |last5=Cimmino |first5=Alessio |last6=Cristofaro |first6=Massimo |last7=Meyer |first7=Susan |last8=Evidente |first8=Antonio |title=Radicinin, a Fungal Phytotoxin as a Target-Specific Bioherbicide for Invasive Buffelgrass (Cenchrus ciliaris) Control |journal=Molecules |date=19 March 2019 |volume=24 |issue=6 |pages=1086 |doi=10.3390/molecules24061086|pmid=30893868 |pmc=6470967 |doi-access=free }} Radicinin is produced by the fungal plant pathogen Alternaria radicina and other Alternaria species.{{cite book |last1=Hanson |first1=James R. |title=Chemistry of Fungi |date=14 August 2008 |publisher=Royal Society of Chemistry |isbn=978-0-85404-136-7 |page=50 |language=en}}