rhoeadine

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 424521737

| Reference =

| ImageFile1= Rhoeadine.svg

| ImageSize1= 200px

| ImageFile2= Rhoeadine-3D-balls.png

| ImageSize2=

| IUPACName = 8β-Methoxy-16-methyl-2′H,2′′H-bis([1,3]dioxolo)[4′,5′:2,3;4′′,5′′:10,11]rhedan

| SystematicName = (5bR,13bR,15S)-15-Methoxy-6-methyl-5b,6,7,8,13b,15-hexahydro-2H,11H-[1,3]dioxolo[4,5-h][1,3]dioxolo[4′,5′:7,8][2]benzopyrano[3,4-a][4]benzazepine

| OtherNames = Rheadine; Rhoeadin

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 171184

| InChI = 1/C21H21NO6/c1-22-6-5-11-7-15-16(26-9-25-15)8-13(11)19-18(22)12-3-4-14-20(27-10-24-14)17(12)21(23-2)28-19/h3-4,7-8,18-19,21H,5-6,9-10H2,1-2H3/t18-,19-,21+/m1/s1

| InChIKey = XRBIHOLQAKITPP-SBHAEUEKBA

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C21H21NO6/c1-22-6-5-11-7-15-16(26-9-25-15)8-13(11)19-18(22)12-3-4-14-20(27-10-24-14)17(12)21(23-2)28-19/h3-4,7-8,18-19,21H,5-6,9-10H2,1-2H3/t18-,19-,21+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XRBIHOLQAKITPP-SBHAEUEKSA-N

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C09619

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL =

| ChEBI = 8836

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=2718-25-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9Q9C65WH3B

| EINECS=

| SMILES = CN1CCC2=CC3=C(C=C2[C@@H]4[C@H]1C5=C([C@H](O4)OC)C6=C(C=C5)OCO6)OCO3

| PubChem = 197775

}}

|Section2={{Chembox Properties

| C=21 | H=21 | N=1 | O=6

| Density = 1.45 g/cm3

| MeltingPt =

| BoilingPt =

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

| HPhrases =

| PPhrases =

| GHS_ref =

}}

}}

Rhoeadine (rheadine) is an alkaloid derived from the flowers of the corn poppy (Papaver rhoeas).{{Cite journal| doi = 10.1021/np50028a001| issn = 0163-3864| volume = 46| issue = 4| pages = 441–453| last1 = Montgomery| first1 = Craig T.| last2 = Cassels| first2 = Bruce K.| last3 = Shamma| first3 = Maurice| title = The Rhoeadine Alkaloids| journal = Journal of Natural Products| accessdate = 2021-04-07| date = 1983-07-01| url = https://doi.org/10.1021/np50028a001| url-access = subscription}} It has been studied for its potential use in the treatment of morphine dependence.{{cite journal | doi = 10.22037/ijpr.2010.757 | year = 2008 | issue = 2 | volume = 7 | last1 = Shams | first1 = J. | title = Effects of Papaver rhoeas Extract on the Tolerance Development to Analgesic Effects of Morphine in Mice | journal = Iranian Journal of Pharmaceutical Research | last2 = Sahraei | first2 = H. | last3 = Faghih-Monzavi | first3 = Z. | last4 = Salimi | first4 = SH | last5 = Fatemi | first5 = SM | last6 = Pourmatabbed | first6 = A. | last7 = Ghoshooni | first7 = H. | last8 = Kamalinejad | first8 = M. }}

Toxicity

5 different patients were admitted to ER after being intoxicated with corn poppy. Symptoms of intoxication include nausea, vomiting, confusion, seizures, myosis and arrhythmia. These symptoms may be an outlier due to the exceptionally high dose ingested.{{Cite journal| doi = 10.1155/2015/321360| issn = 1687-9627| volume = 2015| pages = –321360| last1 = Günaydın| first1 = Yahya Kemal| last2 = Dündar| first2 = Zerrin Defne| last3 = Çekmen| first3 = Bora| last4 = Akıllı| first4 = Nazire Belgin| last5 = Köylü| first5 = Ramazan| last6 = Cander| first6 = Başar| title = Intoxication due to Papaver rhoeas (Corn Poppy): Five Case Reports| journal = Case Reports in Medicine| date = 2015-05-13| pmid = 26074968| pmc = 4444563| doi-access = free}}

References