riligustilide
{{Chembox
| ImageFile = Riligustilide.svg
| ImageSize = 250px
| ImageAlt =
| IUPACName = (3S,3{{prime}}Z,5{{prime}}aR,6{{prime}}S,7{{prime}}aS)-3{{prime}}-Butylidene-6{{prime}}-propylspiro[4,5-dihydro-2-benzofuran-3,7{{prime}}-5,5a,6,7a-tetrahydro-4H-cyclobuta[g][2]benzofuran]-1,1{{prime}}-dione
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 89354-45-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6GB38T262B
| PubChem = 6442656
| SMILES = CCC/C=C\1/C2=C([C@@H]3[C@H](CC2)[C@@H]([C@@]34C5=C(C=CCC5)C(=O)O4)CCC)C(=O)O1
| StdInChI_Ref =
| StdInChI = 1S/C24H28O4/c1-3-5-11-19-16-13-12-14-17(8-4-2)24(21(14)20(16)23(26)27-19)18-10-7-6-9-15(18)22(25)28-24/h6,9,11,14,17,21H,3-5,7-8,10,12-13H2,1-2H3/b19-11-/t14-,17+,21+,24-/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = TYSOMZQRYGBSKN-DRQJQJQISA-N
| ChemSpiderID = 4946720
}}
| Section2 = {{Chembox Properties
| C=24 | H=28 | O=4
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Riligustilide is a nonsteroidal phytoprogestogen that is found in Ligusticum chuanxiong.{{cite journal | vauthors = Lim LS, Shen P, Gong YH, Yong EL | title = Dimeric progestins from rhizomes of Ligusticum chuanxiong | journal = Phytochemistry | volume = 67 | issue = 7 | pages = 728–34 | year = 2006 | pmid = 16516938 | doi = 10.1016/j.phytochem.2006.01.024 }}{{cite journal|last1=Ahmed|first1=H.M.M.|last2=Yeh|first2=J.Y.|last3=Lin|first3=W.J.|last4=Forsberg|first4=N.E.|last5=Cheng|first5=W.T.K.|last6=Ou|first6=B.R|title=Validation of a luciferase bioassay to detect the progestative activity in gilts whose estrus was induced by an uterotonic herb (Ligusticum chuanxiong)|journal=Livestock Science|volume=163|year=2014|pages=159–164|issn=1871-1413|doi=10.1016/j.livsci.2014.02.012}} It is a very weak agonist of the progesterone receptor (EC50 ≈ 81 μM). Another compound in the plant, 3,8-dihydrodiligustilide, is also a phytoprogestogen, but is almost 1,000-fold more potent in comparison (EC50 = 90 nM).
See also
References
{{Reflist|2}}
{{Progesterone receptor modulators}}
{{genito-urinary-drug-stub}}