ritiometan

{{Short description|Chemical compound}}

{{context|date=May 2014}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443589669

| IUPAC_name = 2,2',2''-(methanetriyltrisulfanediyl)triacetic acid

| image = Ritiometan.svg

| tradename = Nécyrane

| Drugs.com = {{drugs.com|international|ritiometan}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Topical (intranasal)

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 34914-39-1

| ATC_prefix = R01

| ATC_suffix = AX05

| PubChem = 65787

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 59206

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J89LM8QVEE

| synonyms = (Methylidynetrithio)triacetic acid

| C=7 | H=10 | O=6 | S=3

| smiles = O=C(O)CSC(SCC(=O)O)SCC(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C7H10O6S3/c8-4(9)1-14-7(15-2-5(10)11)16-3-6(12)13/h7H,1-3H2,(H,8,9)(H,10,11)(H,12,13)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ZBNBQISDCFIEQC-UHFFFAOYSA-N

}}

Ritiometan is an antibacterial used in nasal sprays.NCI Thesaurus: [https://evsexplore.semantics.cancer.gov/evsexplore/concept/ncit/C74155 Ritiometan] Also, it is used in an aerosol preparation for the treatment of infections of the nose and throat.{{Cite web|url=https://www.tititudorancea.com/z/ritiometan.htm|title=What does Ritiometan mean? Definition, meaning and sense|website=www.tititudorancea.com|access-date=2019-01-22}} It is marketed in France under the trade name Nécyrane.{{Drugs.com|international|ritiometan}}: Ritiometan