robenidine
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 448215878
| IUPAC_name = 1,2-Bis[(4-chlorophenyl)methyleneamino]guanidine
| image = Robenidine.png
| tradename =
| Drugs.com = {{drugs.com|international|robenidine}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 25875-51-8
| ATCvet = yes
| ATC_prefix = P51
| ATC_suffix = BX03
| PubChem = 9570438
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4888ME6C4E
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 7844905
| chemical_formula =
| C=15 | H=13 | Cl=2 | N=5
| smiles = C1=CC(=CC=C1C=NNC(=NN=CC2=CC=C(C=C2)Cl)N)Cl
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C15H13Cl2N5/c16-13-5-1-11(2-6-13)9-19-21-15(18)22-20-10-12-3-7-14(17)8-4-12/h1-10H,(H3,18,21,22)/b19-9+,20-10+
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = MOOFYEJFXBSZGE-LQGKIZFRSA-N
}}
Robenidine is a coccidiostat. Robenidine is an antibiotic used for the control of coccidiosis, a debilitating protozoal infection in poultry.{{cite book | vauthors = Mehlhorn H |title=Encyclopedia of Parasitology |date=2008 |publisher=Springer Science & Business Media |location=Berlin |isbn=978-3-540-48994-8 |page=274 |edition=3rd |url=https://books.google.com/books?id=Jpg1ysgVn-AC&dq=Robenidine&pg=PA274}} Although there are alternative antibiotics available, robenidine is important in the management of antibiotic resistance as farmers rotate the use of robenidine with other antibiotics to try to preserve the effectiveness of these products in fighting infections.{{cite web | title = Robenidine review | work = Australian Pesticides and Veterinary Medicines Authority (APVMA)| url = http://www.apvma.gov.au/products/review/completed/robenidine.php | archive-url = https://web.archive.org/web/20140211231613/http://www.apvma.gov.au/products/review/completed/robenidine.php | archive-date = 11 February 2014 }}