rociletinib

{{Short description|Cancelled developmental cancer drug}}

{{Infobox drug

| image = Rociletinib.svg

| alt =

| caption =

| pronounce =

| tradename = Xegafri

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration = By mouth

| class =

| ATCvet =

| ATC_prefix = L01

| ATC_suffix = EB05

| legal_AU =

| legal_AU_comment =

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_UN =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 1374640-70-6

| PubChem = 57335384

| DrugBank =DB11907

| ChemSpiderID = 30646712

| UNII = 72AH61702G

| KEGG = D10858

| synonyms = CO-1686, AVL-301

| IUPAC_name = N-(3-{[2-{[4-(4-Acetyl-1-piperazinyl)-2-methoxyphenyl]amino}-5-(trifluoromethyl)-4-pyrimidinyl]amino}phenyl)acrylamide

| C=27 | H=28 | F=3 | N=7 | O=3

| smiles = CC(=O)N1CCN(CC1)c2ccc(c(c2)OC)Nc3ncc(c(n3)Nc4cccc(c4)NC(=O)C=C)C(F)(F)F

| StdInChI=1S/C27H28F3N7O3/c1-4-24(39)32-18-6-5-7-19(14-18)33-25-21(27(28,29)30)16-31-26(35-25)34-22-9-8-20(15-23(22)40-3)37-12-10-36(11-13-37)17(2)38/h4-9,14-16H,1,10-13H2,2-3H3,(H,32,39)(H2,31,33,34,35)

| StdInChIKey = HUFOZJXAKZVRNJ-UHFFFAOYSA-N

}}

Rociletinib is a medication developed to treat non-small cell lung carcinomas with a specific mutation. It is a third-generation epidermal growth factor receptor tyrosine kinase inhibitor.{{cite journal | vauthors = Van Der Steen N, Caparello C, Rolfo C, Pauwels P, Peters GJ, Giovannetti E | title = New developments in the management of non-small-cell lung cancer, focus on rociletinib: what went wrong? | journal = OncoTargets and Therapy | volume = 9 | pages = 6065–6074 | year = 2016 | pmid = 27785053 | pmc = 5063481 | doi = 10.2147/OTT.S97644 | doi-access = free }} It was being developed by Clovis Oncology as a potential treatment for non-small-cell lung cancer. In May 2016, development of rociletinib was halted, along with its associated clinical trials, and Clovis Oncology withdrew its marketing authorisation application from the European Medicines Agency.