rociverine

{{short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Rociverine.svg

| width =

| alt =

| caption =

| image2 =

| width2 =

| alt2 =

| caption2 =

| imageL =

| widthL =

| altL =

| imageR =

| widthR =

| altR =

| captionLR =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATCvet =

| ATC_prefix = A03

| ATC_suffix = AA06

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 53716-44-2

| CAS_supplemental =

| PubChem = 24892842

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank = DB13581

| ChemSpiderID = 28534065

| UNII = VI08KS44V0

| KEGG = D07078

| ChEBI = 135440

| ChEMBL = 4755537

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = 1-(diethylamino)propan-2-yl (1S,2S)-2-cyclohexyl-2-hydroxycyclohexane-1-carboxylate

| C=20 | H=37 | N=1 | O=3

| molecular_weight =

| SMILES = CCN(CC)CC(C)OC(=O)[C@H]1CCCC[C@@]1(C2CCCCC2)O

| Jmol =

| StdInChI = InChI=1S/C20H37NO3/c1-4-21(5-2)15-16(3)24-19(22)18-13-9-10-14-20(18,23)17-11-7-6-8-12-17/h16-18,23H,4-15H2,1-3H3/t16?,18-,20+/m1/s1

| StdInChI_comment =

| StdInChIKey = XPYLKZZOBVLVHB-QDKIRNHSSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Rociverine is an antispasmodic drug used to treat urinary, gastrointestinal and biliary spasms.{{Cite web |title=Rociverine |url=https://go.drugbank.com/drugs/DB13581}} It is antimuscarinic drug.{{cite journal | vauthors = Toson G, Schiantarelli P, Murmann W | title = Rociverine, a new antispasmodic agent with balanced neurotropic and myotropic activity | journal = Arzneimittel-Forschung | volume = 28 | issue = 7 | pages = 1130–42 | date = 1978 | pmid = 582702 | doi = | url = }}

Medical uses

In India, rociverine is used as part of the "Programmed Labour Protocol" to help reduce pain and shorten the duration of labor. However, an analysis of clinical trials provides little evidence supporting its effectiveness in reducing labor duration.{{cite journal | vauthors = Rohwer AC, Khondowe O, Young T | title = Antispasmodics for labour | journal = The Cochrane Database of Systematic Reviews | volume = 2013 | issue = 6 | pages = CD009243 | date = June 2013 | pmid = 23737030 | pmc = 6823273 | doi = 10.1002/14651858.CD009243.pub3 }}

Pharmacology

The (1R,2R) stereoisomer showed 240-fold greater affinity for the muscarinic receptor, but the (1S,2S) compound showed the best selectivity. {{cite journal | vauthors = Barbier P, Renzetti AR, Turbanti L, Di Bugno C, Fornai F, Vaglini F, Maggio R, Corsini GU | title = Stereoselective inhibition of muscarinic receptor subtypes by the eight stereoisomers related to rociverine | journal = European Journal of Pharmacology | volume = 290 | issue = 2 | pages = 125–132 | date = July 1995 | pmid = 8575526 | doi = 10.1016/0922-4106(95)90024-1 }}

References

{{Reflist}}

{{Drugs for functional gastrointestinal disorders}}

{{Muscarinic acetylcholine receptor modulators}}

Category:Tertiary alcohols

Category:Amines

Category:Carboxylate esters

Category:Muscarinic antagonists

Category:Cyclohexanes