rokitamycin

{{Short description|Type of antibiotic chemical}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 464383231

| IUPAC_name = (2S,3S,4R,6S)-6-{[(2R,3S,4R,5R,6S)-6-{[(4R,5S,6S,7R,9R,10R,11E,13E,16R)-4,10-dihydroxy-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)-1-oxacyclohexadeca-11,13-dien-6-yl]oxy}-4-(dimethylamino)-5-hydroxy-2-methyloxan-3-yl]oxy}-2,4-dimethyl-4-propoxyoxan-3-yl butanoate

| image = rokitamycin.png

| tradename =

| Drugs.com = {{drugs.com|international|rokitamycin}}

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 74014-51-0

| ATC_prefix = J01

| ATC_suffix = FA12

| PubChem = 5282211

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4445397

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ZPT03UEM0E

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1908350

| C=42 | H=71 | N=1 | O=14

| smiles = O=CC[C@H]3C[C@@H](C)[C@@H](O)/C=C/C=C/C[C@H](OC(=O)C[C@@H](O)[C@H](OC)[C@H]3O[C@@H]2O[C@@H]([C@@H](O[C@@H]1O[C@H]([C@H](OC(=O)CCC)[C@](OC(=O)CC)(C1)C)C)[C@H](N(C)C)[C@H]2O)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C42H69NO15/c1-11-16-32(48)55-40-27(6)53-34(23-42(40,7)58-31(47)12-2)56-37-26(5)54-41(36(50)35(37)43(8)9)57-38-28(19-20-44)21-24(3)29(45)18-15-13-14-17-25(4)52-33(49)22-30(46)39(38)51-10/h13-15,18,20,24-30,34-41,45-46,50H,11-12,16-17,19,21-23H2,1-10H3/b14-13+,18-15+/t24-,25-,26-,27+,28+,29+,30-,34+,35-,36-,37-,38+,39+,40+,41+,42-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VYWWNRMSAPEJLS-MDWYKHENSA-N

| melting_point = 116

| solubility = Insoluble in water; Very soluble in chloroform and methanol; Almost completely (>99.5%) in ethanol and acetonitrile.

}}

Rokitamycin is a macrolide antibiotic synthesized from strains of Streptomyces kitasatoensis.{{cite journal | vauthors = Braga PC | title = Rokitamycin: bacterial resistance to a 16-membered ring macrolide differs from that to 14- and 15-membered ring macrolides | journal = Journal of Chemotherapy | location = Florence, Italy | volume = 14 | issue = 2 | pages = 115–31 | date = April 2002 | pmid = 12017366 | doi = 10.1179/joc.2002.14.2.115 | s2cid = 1250525 }}