romifidine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 448113917

| IUPAC_name = N-(2-bromo-6-fluorophenyl)-4,5-dihydro-1H-imidazol-2-amine

| image = Romifidine.svg

| tradename =

| Drugs.com = {{drugs.com|international|romifidine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Veterinary use only

| routes_of_administration = IV

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 65896-16-4

| ATCvet = yes

| ATC_prefix = N05

| ATC_suffix = CM93

| PubChem = 71969

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 876351L05K

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 64975

| C=9 | H=9 | Br=1 | F=1 | N=3

| smiles = C1CN=C(N1)NC2=C(C=CC=C2Br)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C9H9BrFN3/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9/h1-3H,4-5H2,(H2,12,13,14)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = KDPNLRQZHDJRFU-UHFFFAOYSA-N

}}

Romifidine is a drug that is used in veterinary medicine as a sedative mainly in large animals such as horses,{{cite journal | vauthors = Spadavecchia C, Arendt-Nielsen L, Andersen OK, Spadavecchia L, Schatzmann U | title = Effect of romifidine on the nociceptive withdrawal reflex and temporal summation in conscious horses | journal = American Journal of Veterinary Research | volume = 66 | issue = 11 | pages = 1992–8 | date = November 2005 | pmid = 16334961 | doi = 10.2460/ajvr.2005.66.1992 | doi-access = free }} although it may be used in a wide variety of species.{{cite journal | vauthors = De Lucas JJ, Rodríguez C, Marín M, González F, Ballesteros C, San Andrés MI | title = Pharmacokinetics of intramuscular ketamine in young ostriches premedicated with romifidine | journal = Journal of Veterinary Medicine. A, Physiology, Pathology, Clinical Medicine | volume = 54 | issue = 1 | pages = 48–50 | date = February 2007 | pmid = 17359455 | doi = 10.1111/j.1439-0442.2007.00910.x | doi-access = free }}{{cite journal | vauthors = Belda E, Laredo FG, Escobar M, Soler M, Lucas X, Agut A | title = Sedative and cardiorespiratory effects of three doses of romifidine in comparison with medetomidine in five cats | journal = The Veterinary Record | volume = 162 | issue = 3 | pages = 82–7 | date = January 2008 | pmid = 18204032 | doi = 10.1136/vr.162.3.82 | s2cid = 41300654 }} It is not used in humans, but is closely related in structure to the commonly used drug clonidine.

Romifidine acts as an agonist at the α2 adrenergic receptor subtype. Side effects can include bradycardia and respiratory depression. It is often used alongside other sedative or analgesic drugs such as ketamine or butorphanol.{{cite journal | vauthors = Corletto F, Raisis AA, Brearley JC | title = Comparison of morphine and butorphanol as pre-anaesthetic agents in combination with romifidine for field castration in ponies | journal = Veterinary Anaesthesia and Analgesia | volume = 32 | issue = 1 | pages = 16–22 | date = January 2005 | pmid = 15663735 | doi = 10.1111/j.1467-2995.2004.00184.x }}{{cite journal | vauthors = Kerr CL, McDonell WN, Young SS | title = Cardiopulmonary effects of romifidine/ketamine or xylazine/ketamine when used for short duration anesthesia in the horse | journal = Canadian Journal of Veterinary Research | volume = 68 | issue = 4 | pages = 274–82 | date = October 2004 | pmid = 15581222 | pmc = 1111358 }} Yohimbine can be used as an antidote to rapidly reverse the effects.

References