ronifibrate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 464383547

| IUPAC_name = 3-{[2-(4-chlorophenoxy)-2-methylpropanoyl]oxy}propyl nicotinate

| image = Ronifibrate.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 42597-57-9

| ATC_prefix = C10

| ATC_suffix = AB07

| PubChem = 68671

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 61925

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = W86I18X716

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 153983

| C=19 | H=20 | Cl=1 | N=1 | O=5

| smiles = O=C(OCCCOC(=O)C(Oc1ccc(Cl)cc1)(C)C)c2cccnc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H20ClNO5/c1-19(2,26-16-8-6-15(20)7-9-16)18(23)25-12-4-11-24-17(22)14-5-3-10-21-13-14/h3,5-10,13H,4,11-12H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AYJVGKWCGIYEAK-UHFFFAOYSA-N

| synonyms = 3-[(pyridin-3-yl)carbonyloxy]propyl 2-(4-chlorophenoxy)-2-methylpropanoate

}}

Ronifibrate is a fibrate, a hypolipidemic agent. It is a combined ester of clofibric acid and niacin (nicotinic acid) with 1,3-propanediol. In the body, the ester is split to 1,3-propanediol and both acids which work in the same way, lowering lipids in blood.