rumenic acid

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447321268

| Name = Rumenic acid

| ImageFile = Rumenic acid.svg

| ImageSize = 200px

| ImageName = Rumenic acid

| PIN = (9Z,11E)-Octadeca-9,11-dienoic acid

| OtherNames = Bovinic acid; C9-T11 acid

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 2540-56-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 46JZW3MR59

| SMILES = CCCCCC\C=C/C=C/CCCCCCCC(=O)O

| PubChem = 5280644

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4444245

| InChI = 1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9-

| InChIKey = JBYXPOFIGCOSSB-GOJKSUSPBK

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9-

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JBYXPOFIGCOSSB-GOJKSUSPSA-N

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 32798

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C04056

}}

| Section2 = {{Chembox Properties

| C=18|H=32|O=2

| Density =

| MeltingPt =

| BoilingPt =

}}

}}

Rumenic acid, also known as bovinic acid, is a conjugated linoleic acid (CLA) found in the fat of ruminants and in dairy products. It is an omega-7 trans fatty acid. Its lipid shorthand name is cis-9, trans-11 18:2 acid. The name was proposed by Kramer et al. in 1998.{{cite journal |vauthors=Kramer J, Parodi P, Jensen R, Mossoba M, Yurawecz M, Adlof R |title=Rumenic acid: a proposed common name for the major conjugated linoleic acid isomer found in natural products |journal=Lipids |volume=33 |issue=8 |page=835 |year=1998 |pmid=9727617 |doi=10.1007/s11745-998-0279-6|s2cid=10693714 }} It can be considered as the principal dietary form, accounting for as much as 85-90% of the total CLA content in dairy products.{{cite web

| url=http://www.cyberlipid.org/fa/acid0003.htm

| title= Polyenoic Fatty Acids

| author=Cyberlipid| accessdate=2007-01-17}}