sabeluzole

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 451729293

| IUPAC_name = 1-[4-[1,3-benzothiazol-2-yl(methyl)amino]piperidin-1-yl]-3-(4-fluorophenoxy)propan-2-ol

| image = Sabeluzole.svg

| width = 260

| tradename =

| pregnancy_category =

| legal_status = Unscheduled

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number = 104383-17-7

| ATC_prefix = none

| PubChem = 59823

| ChemSpiderID = 53964

| StdInChI = 1S/C22H26FN3O2S/c1-25(22-24-20-4-2-3-5-21(20)29-22)17-10-12-26(13-11-17)14-18(27)15-28-19-8-6-16(23)7-9-19/h2-9,17-18,27H,10-15H2,1H3

| StdInChIKey = IGMKTIJBFUMVIN-UHFFFAOYSA-N

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = A998504XY4

| C=22 | H=26 | F=1 | N=3 | O=2 | S=1

| smiles = CN(C1CCN(CC1)CC(COC2=CC=C(C=C2)F)O)C3=NC4=CC=CC=C4S3

}}

Sabeluzole (R-58,735) is a nootropic and neuroprotective drug which was originally developed for the treatment of Alzheimer's disease,{{cite journal | vauthors = Clincke GH, Tritsmans L, Idzikowski C, Amery WK, Janssen PA | title = The effect of R 58 735 (Sabeluzole) on memory functions in healthy elderly volunteers | journal = Psychopharmacology | volume = 94 | issue = 1 | pages = 52–7 | year = 1988 | pmid = 3126527 | doi = 10.1007/BF00735880 | s2cid = 28451054 }}{{cite journal | vauthors = Mohr E, Nair NP, Sampson M, Murtha S, Belanger G, Pappas B, Mendis T | title = Treatment of Alzheimer's disease with sabeluzole: functional and structural correlates | journal = Clinical Neuropharmacology | volume = 20 | issue = 4 | pages = 338–45 | date = August 1997 | pmid = 9260731 | doi = 10.1097/00002826-199708000-00005 }} and has subsequently been researched for other applications such as sleep apnoea.{{cite journal | vauthors = Hedner J, Grunstein R, Eriksson B, Ejnell H | title = A double-blind, randomized trial of sabeluzole--a putative glutamate antagonist--in obstructive sleep apnea | journal = Sleep | volume = 19 | issue = 4 | pages = 287–9 | date = May 1996 | pmid = 8776785 | doi = 10.1093/sleep/19.4.287 | doi-access = }} It acts primarily as an NMDA antagonist,{{cite journal | vauthors = Van der Valk JB, Vijverberg HP | title = Chronic sabeluzole treatment of cultured rat cerebellar granule cells reduces N-methyl-D-aspartate-induced inward current | journal = European Journal of Pharmacology | volume = 232 | issue = 1 | pages = 131–4 | date = February 1993 | pmid = 8458392 | doi = 10.1016/0014-2999(93)90738-4 }} but other mechanisms of action may also be important.{{cite journal | vauthors = Geerts H, Nuydens R, De Jong M, Cornelissen F, Nuyens R, Wouters L | title = Sabeluzole stabilizes the neuronal cytoskeleton | journal = Neurobiology of Aging | volume = 17 | issue = 4 | pages = 573–81 | year = 1996 | pmid = 8832632 | doi = 10.1016/0197-4580(96)00067-x | s2cid = 25920662 }}{{cite journal | vauthors = Uberti D, Rizzini C, Galli P, Pizzi M, Grilli M, Lesage A, Spano P, Memo M | display-authors = 6 | title = Priming of cultured neurons with sabeluzole results in long-lasting inhibition of neurotoxin-induced tau expression and cell death | journal = Synapse | volume = 26 | issue = 2 | pages = 95–103 | date = June 1997 | pmid = 9131769 | doi = 10.1002/(SICI)1098-2396(199706)26:2<95::AID-SYN1>3.0.CO;2-8 | hdl = 11379/164175 | url = https://iris.unibs.it/bitstream/11379/164175/1/Synapse%201997.pdf | hdl-access = free }}