salicyl alcohol

{{chembox

| Name = Salicyl alcohol

| ImageFile = Salicyl alcohol.svg

| PIN = 2-(Hydroxymethyl)phenol

| OtherNames = 2-Hydroxybenzyl alcohol, Salicain, Diathesin, Saligenin, Saligenol, Salicyl alcohol, α,2-Toluenediol, o-Methylolphenol, 2-Methylolphenol, Salicylic alcohol{{cite web|url=http://www.chemicalbook.com/ChemicalProductProperty_EN_CB9303076.htm|title=2-Hydroxybenzyl alcohol|work=chemicalbook.com}}

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 90-01-7

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = FA1N0842KB

| ChEMBL_Ref =

| ChEMBL =

| ChemSpiderID_Ref =

| ChemSpiderID = 4962

| ChEBI_Ref =

| ChEBI =

| DrugBank_Ref =

| DrugBank =

| EINECS = 201-960-5

| KEGG_Ref =

| KEGG =

| PubChem = 5146

| SMILES = c1ccc(c(c1)CO)O

| StdInChI_Ref =

| StdInChI = InChI=1S/C7H8O2/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2

| StdInChIKey_Ref =

| StdInChIKey = CQRYARSYNCAZFO-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=7 | H=8 | O=2

| Density = 1.16 g/cm³

| MeltingPtC = 86

| BoilingPtC = 267

| Solubility = 67g/L at 22 °C{{cite web|url=http://www.chemspider.com/Chemical-Structure.4962.html|title=salicylic alcohol|work=chemspider.com}}

| MagSus = −76.9·10⁻⁶ cm³/mol

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| FlashPt = 134 °C

| NFPA-H =

| NFPA-F =

| NFPA-R =

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|H315|319|335}}

| PPhrases = {{P-phrases|P261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

}}

}}

Salicyl alcohol (saligenin) is an organic compound with the formula {{chem2|C6HOH(CH2OH}}. It is a white solid that is used as a precursor in organic synthesis.{{cite journal |doi=10.15227/orgsyn.081.0171|title=Synthesis of 9-Spiroepoxy-endo-Tricyclo[5.2.2.0]undeca-4,10-dien-8-one|journal=Organic Syntheses|year=2005|volume=81|page=171|author=Vishwakarma Singh, Mini Porinchu, Punitha Vedantham, Pramod K. Sahu1|doi-access=free}}