salmefamol

{{Short description|Adrenergic bronchodilator}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| image = Salmefamol.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration = Inhalation, intravenous

| class = Bronchodilator; β-Adrenergic receptor agonist

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 18910-65-1

| CAS_supplemental =

| PubChem = 86805

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 78303

| UNII = Q56SEY8X9J

| KEGG = C11771

| ChEBI =

| ChEMBL = 2107072

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = AH-3923; AHR-3929; 1-(4-hydroxy-3-(hydroxymethyl)phenyl)-2-(4-methoxy-α-methylphenethylamino)ethanol

| IUPAC_name = 4-[1-hydroxy-2-[1-(4-methoxyphenyl)propan-2-ylamino]ethyl]-2-(hydroxymethyl)phenol

| C=19 | H=25 | N=1 | O=4

| SMILES = CC(CC1=CC=C(C=C1)OC)NCC(C2=CC(=C(C=C2)O)CO)O

| StdInChI = 1S/C19H25NO4/c1-13(9-14-3-6-17(24-2)7-4-14)20-11-19(23)15-5-8-18(22)16(10-15)12-21/h3-8,10,13,19-23H,9,11-12H2,1-2H3

| StdInChIKey = VPMWDFRZSIMDKW-UHFFFAOYSA-N

}}

Salmefamol ({{Abbrlink|INN|International Nonproprietary Name}}, {{Abbrlink|BAN|British Approved Name}}; developmental code name AH-3923) is a drug of the phenethylamine and amphetamine families described as a bronchodilator which was never marketed.{{cite book | vauthors = Elks J | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA1089 | access-date=17 October 2024 | page=1089}} It is a β-adrenergic receptor agonist with some selectivity for the β₂-adrenergic receptor{{cite journal | vauthors = Labrid C, Rocher I, Guery O | title = Structure-activity relationships as a response to the pharmacological differences in beta-receptor ligands | journal = American Journal of Hypertension | volume = 2 | issue = 11 Pt 2 | pages = 245S–251S | date = November 1989 | pmid = 2573372 | doi = 10.1093/ajh/2.11.245s }}{{cite journal | vauthors = Leclerc G, Rouot B, Velly J, Schwartz J | title=β-Adrenergic receptor subtypes | journal=Trends in Pharmacological Sciences | publisher=Elsevier BV | volume=2 | year=1981 | issn=0165-6147 | doi=10.1016/0165-6147(81)90248-0 | pages=18–20}} and has been described as a "sister compound" to salbutamol.{{cite book | vauthors = Clayden J, Greeves N, Warren S | title=Organic Chemistry | publisher=OUP Oxford | year=2012 | isbn=978-0-19-927029-3 | url=https://books.google.com/books?id=kQgu2j_ber0C&pg=PA530 | access-date=17 October 2024 | page=530}} However, the drug is more potent (1.5-fold), longer-acting (6{{nbsp}}hours), and more lipophilic in comparison to salbutamol.{{cite book | last=Kummer | first=F. | title=Treatment of Asthma: The long-acting beta-2-agonists | publisher=Springer Vienna | year=2012 | isbn=978-3-7091-7513-2 | url=https://books.google.com/books?id=LNNeBAAAQBAJ&pg=PT38 | access-date=17 October 2024 | page=38}}{{cite book | vauthors = Patrick GL | title=An Introduction to Medicinal Chemistry | publisher=Oxford University Press | year=2017 | isbn=978-0-19-874969-1 | url=https://books.google.com/books?id=bBqeDgAAQBAJ&pg=PA665 | access-date=17 October 2024 | page=665}} It was intended for inhalational or intravenous administration. Salmefamol was first described in the literature by 1968.