salutaridine

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 376119456

|ImageFile=Salutaridine.svg

|ImageSize=200

|ImageFile2=Salutaridine 3D BS.png

|ImageSize2=200

|IUPACName=4-Hydroxy-3,6-dimethoxy-17-methyl-5,6,8,14-tetradehydromorphinan-7-one

|SystematicName=(4aS,10R)-5-Hydroxy-3,6-dimethoxy-11-methyl-9,10-dihydro-2H-10,4a-(azanoethano)phenanthren-2-one

|OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=1936-18-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7X10PRH74D

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C05179

| PubChem=5408233

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 17225

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 404097

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 16736005

| InChI = 1/C19H21NO4/c1-20-7-6-19-10-16(24-3)14(21)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9-10,13,22H,6-8H2,1-3H3/t13-,19+/m1/s1

| InChIKey = GVTRUVGBZQJVTF-YJYMSZOUBK

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C19H21NO4/c1-20-7-6-19-10-16(24-3)14(21)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9-10,13,22H,6-8H2,1-3H3/t13-,19+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = GVTRUVGBZQJVTF-YJYMSZOUSA-N

| SMILES=CN1CC[C@]23C=C(C(=O)C=C2[C@H]1CC4=C3C(=C(C=C4)OC)O)OC

}}

|Section2={{Chembox Properties

| C=19 | H=21 | N=1 | O=4

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

}}

Salutaridine, also known as floripavine,{{cite web|title=Floripavine ChemicalBook|url=http://www.chemicalbook.com/ProdSupplierGWCB91907730_EN.htm}} is an alkaloid that is present in the morphinian alkaloid pathway of opium poppy. Its biosynthetic precursor is the alkaloid (R)-reticuline. (R)-Reticuline is converted to salutaridine by the enzyme salutaridine synthase. Salutaridine is converted to salutaridinol by the enzyme salutaridine reductase (SalR), with the reduction of NADPH to NADP⁺.