sarmazenil

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 449586590

| IUPAC_name = Ethyl 7-chloro-5-methyl-6-oxo-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate

| image = Sarmazenil.svg

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 46547

| tradename =

| Drugs.com = {{drugs.com|international|sarmazenil}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 78771-13-8

| CAS_supplemental =

| ATCvet = yes

| ATC_prefix = V03

| ATC_suffix = AB91

| ATC_supplemental =

| PubChem = 71231

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = F84AE7X24P

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 64366

| chemical_formula =

| C=15 | H=14 | Cl=1 | N=3 | O=3

| smiles = CCOC(=O)C1=C2CN(C(=O)C3=C(N2C=N1)C=CC=C3Cl)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C15H14ClN3O3/c1-3-22-15(21)13-11-7-18(2)14(20)12-9(16)5-4-6-10(12)19(11)8-17-13/h4-6,8H,3,7H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = WSDBAFQWNWJTNG-UHFFFAOYSA-N

}}

Sarmazenil (Ro15-3505) is a drug from the benzodiazepine family. It acts as a partial inverse agonist of benzodiazepine receptors,{{cite journal | vauthors = López-Romero B, Evrard G, Durant F, Sevrin M, George P | title = Molecular structure and stereoelectronic properties of sarmazenil--a weak inverse agonist at the omega modulatory sites (benzodiazepine receptors): comparison with bretazenil and flumazenil | journal = Bioorganic & Medicinal Chemistry | volume = 6 | issue = 10 | pages = 1745–57 | date = October 1998 | pmid = 9839004 | doi = 10.1016/S0968-0896(98)00117-5 }} meaning that it causes the opposite effects to most benzodiazepine drugs, and instead acts as an anxiogenic and convulsant. It is used in veterinary medicine to reverse the effects of benzodiazepine sedative drugs in order to rapidly re-awaken anesthetized animals.{{cite journal | vauthors = Henke J, Roberts U, Otto K, Lendl C, Matis U, Brill T, Erhardt W | title = [Clinical investigations of an i.m. combination anesthesia with fentanylclimazolam/xylazine and postoperative i.v. antagonism with naloxone/sarmazenil/yohimbine in guinea pigs] | language = German | journal = Tierarztliche Praxis | volume = 24 | issue = 1 | pages = 85–7 | date = February 1996 | pmid = 8720962 }}{{cite journal | vauthors = Janovsky M, Tataruch F, Ambuehl M, Giacometti M | title = A Zoletil-Rompun mixture as an alternative to the use of opioids for immobilization of feral red deer | journal = Journal of Wildlife Diseases | volume = 36 | issue = 4 | pages = 663–9 | date = October 2000 | pmid = 11085427 | doi = 10.7589/0090-3558-36.4.663 | doi-access = free }}{{cite journal | vauthors = Walzer C, Huber C | title = Partial antagonism of tiletamine-zolazepam anesthesia in cheetah | journal = Journal of Wildlife Diseases | volume = 38 | issue = 2 | pages = 468–72 | date = April 2002 | pmid = 12038151 | doi = 10.7589/0090-3558-38.2.468 | s2cid = 31934971 }}