satavaptan

{{short description|Chemical compound}}

{{Infobox drug

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 455169440

| drug_name = Satavaptan

| IUPAC_name = N-(tert-butyl)-4-{[(1s,4s)-5'-ethoxy-4-(2-morpholin-4-ylethoxy)-2'-oxospiro[cyclohexane-1,3'-indol]-1'(2'H)-yl]sulfonyl}-3-methoxybenzamide

| image = Satavaptan structure.svg

| width = 200

| tradename =

| legal_status =

| routes_of_administration =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 185913-78-4

| ATC_prefix = none

| PubChem = 9810773

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| synonyms = SR121463

| UNII = AJS8S3P31H

| C = 33

| H = 45

| N = 3

| O = 8

| S = 1

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 32699105

| smiles = C1COCCN1CCO[C@H]2CC[C@](CC2)3c4cc(OCC)ccc4N(C3=O)S(=O)(=O)c5ccc(cc5OC)C(=O)NC(C)(C)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C33H45N3O8S/c1-6-43-25-8-9-27-26(22-25)33(13-11-24(12-14-33)44-20-17-35-15-18-42-19-16-35)31(38)36(27)45(39,40)29-10-7-23(21-28(29)41-5)30(37)34-32(2,3)4/h7-10,21-22,24H,6,11-20H2,1-5H3,(H,34,37)/t24-,33+

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QKXJWFOKVQWEDZ-VCCCEUOBSA-N

}}

Satavaptan (INN; developmental code name SR121463, former tentative brand name Aquilda) is a vasopressin V₂ receptor antagonist{{cite journal | vauthors = Soupart A, Gross P, Legros JJ, Alföldi S, Annane D, Heshmati HM, Decaux G | title = Successful long-term treatment of hyponatremia in syndrome of inappropriate antidiuretic hormone secretion with satavaptan (SR121463B), an orally active nonpeptide vasopressin V2-receptor antagonist | journal = Clinical Journal of the American Society of Nephrology | volume = 1 | issue = 6 | pages = 1154–60 | date = November 2006 | pmid = 17699341 | doi = 10.2215/CJN.00160106 | doi-access = free }} which was investigation by Sanofi-Aventis and was under development for the treatment of hyponatremia. It was also being studied for the treatment of ascites.{{cite journal | vauthors = Ginès P, Wong F, Watson H, Milutinovic S, del Arbol LR, Olteanu D | title = Effects of satavaptan, a selective vasopressin V(2) receptor antagonist, on ascites and serum sodium in cirrhosis with hyponatremia: a randomized trial | journal = Hepatology | volume = 48 | issue = 1 | pages = 204–13 | date = July 2008 | pmid = 18508290 | doi = 10.1002/hep.22293 | doi-access = free }} Development was discontinued in 2009.{{cite web | title = Satavaptan | url = http://adisinsight.springer.com/drugs/800007591 | work = Adis Insight | publisher = Springer Nature Switzerland AG }}