scopolin

{{Chembox

|ImageFile = Scopolin structure.svg

|ImageSize = 180px

|IUPACName = 7-(β-D-Glucopyranosyloxy)-6-methoxy-2H-1-benzopyran-2-one

|SystematicName = 6-Methoxy-7-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2H-1-benzopyran-2-one

|Section1={{Chembox Identifiers

|CASNo = 531-44-2

|CASNo_Ref = {{cascite|correct|CAS}}

|UNII_Ref = {{fdacite|correct|FDA}}

|UNII = 1Y49270PY8

|PubChem = 439514

|SMILES = COC1=C(C=C2C(=C1)C=CC(=O)O2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O

|ChemSpiderID = 388609

|ChEBI_Ref = {{ebicite|correct|EBI}}

|ChEBI = 16065

|InChI = 1/C16H18O9/c1-22-9-4-7-2-3-12(18)23-8(7)5-10(9)24-16-15(21)14(20)13(19)11(6-17)25-16/h2-5,11,13-17,19-21H,6H2,1H3/t11-,13-,14+,15-,16-/m1/s1

|InChIKey = SGTCGCCQZOUMJJ-YMILTQATBT

|StdInChI = 1S/C16H18O9/c1-22-9-4-7-2-3-12(18)23-8(7)5-10(9)24-16-15(21)14(20)13(19)11(6-17)25-16/h2-5,11,13-17,19-21H,6H2,1H3/t11-,13-,14+,15-,16-/m1/s1

|StdInChIKey = SGTCGCCQZOUMJJ-YMILTQATSA-N

}}

|Section2={{Chembox Properties

|C=16 | H=18 | O=9

}}

}}

Scopolin is a glucoside of scopoletin formed by the action of the enzyme scopoletin glucosyltransferase.{{cite journal | author = Hino F, Okazaki M and Miura Y | year = 1982 | title = Effect of 2,4-dichlorophenoxyacetic acid on glucosylation of scopoletin to scopolin in tobacco tissue-culture | journal = Plant Physiol. | volume = 69 | pages = 810–813 | doi = 10.1104/pp.69.4.810 | pmid=16662301 | issue = 4 | pmc = 426310}} It occurs in Chamaemelum nobile.{{Cite book |last1=Hänsel |first1=Rudolf |url=https://link.springer.com/book/10.1007/978-3-642-00963-1 |title=Pharmakognosie – Phytopharmazie |last2=Sticher |first2=Otto |publisher=Springer Medizin Verlag |year=2010 |isbn=978-3-642-00962-4 |edition=9th |pages=1076 |doi=10.1007/978-3-642-00963-1 |language=de}}